
CAS Number118468-34-1
Synonyms3.4-bis(decyloxy)benzaldehyde; 3,4-didecyloxybenzaldehyde; di-decyloxy-3,4 benzaldehyde; 3′,4′-(Didecyloxy)benzaldehyde
Molecular FormulaC14H11ClO2
Molecular Weight418.65200
Density0.938g/cm3
Boiling Point522.4ºC at 760 mmHg
Melting Point61-66ºC
AppearanceLight yellow to beige flakes
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 118468-34-1 |
| Catalog No. | 2A-9080649 |
| Chinese Name | 3',4'-(二葵氧荃)苯甲醛 |
| Synonyms | 3.4-bis(decyloxy)benzaldehyde; 3,4-didecyloxybenzaldehyde; di-decyloxy-3,4 benzaldehyde; 3′,4′-(Didecyloxy)benzaldehyde |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 418.65200 |
| Density | 0.938g/cm3 |
| Boiling Point | 522.4ºC at 760 mmHg |
| Melting Point | 61-66ºC |
| Appearance | Light yellow to beige flakes |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2912499000 |
| MDL Number | MFCD08446942 |
| SMILES | O=C([H])C1=CC=C(C=C1)OC2=CC(C)=C(Cl)C=C2 |
| InChI | 1S/C14H11ClO2/c1-10-8-13(6-7-14(10)15)17-12-4-2-11(9-16)3-5-12/h2-9H,1H3 |
| InChI Key | SOUQMHCBVSIYKA-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/80649_1_118468_34_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3',4'-Dimethylbiphenyl-4-carbaldehyde | 343604-05-7 | 2A-9080643 |
| 4-Methyl-1-naphthaldehyde | 33738-48-6 | 2A-9080645 |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 380151-86-0 | 2A-9080646 |
| (2-Formyl-4,5-methylenedioxy)benzeneboronicacid | 94838-88-7 | 2A-9080647 |
| 3',4'-(Didodecyloxy)benzaldehyde | 117241-25-5 | 2A-9080648 |
| 3',4'-(Dioctyloxy)benzaldehyde | 131525-50-3 | 2A-9080650 |
| 4-Benzyloxy-3,5-dimethylbenzaldehyde | 144896-51-5 | 2A-9080651 |
| 2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde | 175203-16-4 | 2A-9080652 |
| 4-Hex-1-Ynylbenzaldehyde | 175203-90-4 | 2A-9080653 |
| 5-Nitro-2-(2-pyridylithio)benzaldehyde | 175278-54-3 | 2A-9080654 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA