
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 131525-50-3 |
| Catalog No. | 2A-9080650 |
| Chinese Name | 3,4-(二辛基氧)苯甲醛 |
| Synonyms | 3,4-dioctyloxybenzaldehyde; MFCD00143011; 3,4-bisoctyloxy-benzaldehyde |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 270.32 |
| Density | 0.953g/cm3 |
| Boiling Point | 473.3ºC at 760mmHg |
| Melting Point | 54-56ºC |
| Appearance | solid |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2912499000 |
| PubChem ID | 329818874 |
| MDL Number | MFCD08143640 |
| SMILES | O(CCCc2ccccc2)c1c(cc(cc1)C=O)OC |
| InChI | 1S/C17H18O3/c1-19-17-12-15(13-18)9-10-16(17)20-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3 |
| InChI Key | MZHDYOYRBPXBNG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/80650_1_131525_50_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Methyl-1-naphthaldehyde | 33738-48-6 | 2A-9080645 |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 380151-86-0 | 2A-9080646 |
| (2-Formyl-4,5-methylenedioxy)benzeneboronicacid | 94838-88-7 | 2A-9080647 |
| 3',4'-(Didodecyloxy)benzaldehyde | 117241-25-5 | 2A-9080648 |
| 3',4'-(Didecyloxy)benzaldehyde | 118468-34-1 | 2A-9080649 |
| 4-Benzyloxy-3,5-dimethylbenzaldehyde | 144896-51-5 | 2A-9080651 |
| 2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde | 175203-16-4 | 2A-9080652 |
| 4-Hex-1-Ynylbenzaldehyde | 175203-90-4 | 2A-9080653 |
| 5-Nitro-2-(2-pyridylithio)benzaldehyde | 175278-54-3 | 2A-9080654 |
| 2-Hydroxy-5-chloromethylbenzaldehyde | 23731-06-8 | 2A-9080656 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA