
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9004-65-3 |
| Catalog No. | 2A-9008016 |
| Chinese Name | 羟丙基甲基纤维素 |
| Synonyms | Hydroxypropyl methyl cellulose; EINECS 220-971-6; MHPC; Hydroxypropyl methylcellulose; MFCD00131360; E464; HPMC |
| Molecular Formula | C18H38O14 |
| Molecular Weight | 478.49 |
| Purity | 98.00 |
| Density | 1.39 |
| Appearance | powder |
| Water Solubility | H2O: 50 mg/mL, clear to very faintly turbid, faint |
| Storage Condition | 1. Packed in a plastic bag with multiple layers of |
| Application | Hypromellose is a water-soluble, hydrophilic, non-ionic cellulose ether used to form a swollen solubility matrix. |
| MDL Number | MFCD00131360 |
| SMILES | O3[C@H]([C@@H]([C@H]([C@@H]([C@H]3COCC(O)C)OCC(O)C)OCC(O)C)OCC(O)C)O[C@@H]4[C@H](O[C@H]([C@@H]([C@H]4OCC(O)C)OCC(O)C)OCC(O)C)COCC(O)C.O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1COC)OC)OC)OC)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2OC)OC)OC)COC |
| InChI | 1S/C36H70O19.C20H38O11/c1-19(37)9-45-17-27-29(47-11-21(3)39)31(48-12-22(4)40)34(51-15-25(7)43)36(54-27)55-30-28(18-46-10-20(2)38)53-35(52-16-26(8)44)33(50-14-24(6)42)32(30)49-13-23(5)41;1-21-9-11-13(23-3)15(24-4)18(27-7)20(30-11)31-14-12(10-22-2)29-19(28- |
| InChI Key | PUSNGFYSTWMJSK-GSZQVNRLSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352201 |
| MSDS | msds/8016_1_9004_65_3.pdf |
| Transport Info | Product Name: Hypromellose |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Hydrobromic acid | 10035-10-6 | 2A-9008008 |
| Hydrogen fluoridecollidine | 45725-47-1 | 2A-9008012 |
| Hydroxycarbamide | 127-07-1 | 2A-9008013 |
| Hydroxylamine sulfate | 10039-54-0 | 2A-9008014 |
| Hydroxylamine-O-sulfonic acid | 2950-43-8 | 2A-9008015 |
| Hypoxanthine | 68-94-0 | 2A-9008018 |
| Picaridin | 119515-38-7 | 2A-9008019 |
| Imidocarb dipropionate | 55750-06-6 | 2A-9008022 |
| Iminodibenzyl-5-carbonyl chloride | 33948-19-5 | 2A-9008023 |
| Inosinate 5'-diphosphate | 86-04-4 | 2A-9008055 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA