
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-96-3 |
| Catalog No. | 2A-9077887 |
| Chinese Name | 3-氯-2-氟苯乙酸 |
| Synonyms | 3-Chloro-2-fluorophenylacetic acid; MFCD01631554 |
| Molecular Formula | C8H6ClFO2 |
| Molecular Weight | 188.59 |
| Density | 1.417g/cm3 |
| Boiling Point | 296.4ºC at 760mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| PubChem ID | 3209075 |
| SMILES | O=C(O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C8H6ClFO2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) |
| InChI Key | LBGHWXGWKTZILK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Dimethoxybenzenethiol | 26163-11-1 | 2A-9077879 |
| 2-Chloro-3,6-difluoroanisole | 261762-37-2 | 2A-9077883 |
| 2-Chloro-3,6-difluorophenol | 261762-50-9 | 2A-9077884 |
| 2-Chloro-5-fluorobenzylalcohol | 261762-59-8 | 2A-9077885 |
| 2-Chloro-6-fluoro-3-Methylphenylaceticacid | 261762-92-9 | 2A-9077886 |
| 3-Chloro-4-(trifluoromethoxy)benzylbromide | 261763-18-2 | 2A-9077889 |
| 5-(Benzyloxy)-2-(hydroxymethyl)pyridin-4-ol | 165948-37-8 | 2A-9077891 |
| 2,6-Difluoro-3-methylbenzylbromide | 261763-44-4 | 2A-9077893 |
| 3-Fluoro-4-methylbenzylamine | 261951-67-1 | 2A-9077899 |
| 4-Fluoro-3-methylbenzylamine | 261951-68-2 | 2A-9077900 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA