
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-50-9 |
| Catalog No. | 2A-9077884 |
| Chinese Name | 2-氯-3,6-二氟苯酚 |
| Synonyms | MFCD01631450; 2-Chloro-3,6-difluoro-phenol; 2-chloro-3,6-fluorophenol |
| Molecular Formula | C6H3O1Cl1F2 |
| Molecular Weight | 164.54 |
| Density | 1.52g/cm3 |
| Boiling Point | 171.7ºC at 760mmHg |
| Melting Point | 52-56ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2908199090 |
| PubChem ID | 3208893 |
| MDL Number | MFCD01631450 |
| SMILES | Oc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C6H3ClF2O/c7-5-3(8)1-2-4(9)6(5)10/h1-2,10H |
| InChI Key | IXIZSAAJTPZUBU-UHFFFAOYSA-N |
| MSDS | msds/77884_1_261762_50_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl2-methoxyisonicotinate | 26156-51-4 | 2A-9077869 |
| 5-Cyano-2-fluoro-3-picoline | 261625-67-6 | 2A-9077871 |
| 1,3-Diphenylisothianaphthene | 16587-39-6 | 2A-9077878 |
| 2,6-Dimethoxybenzenethiol | 26163-11-1 | 2A-9077879 |
| 2-Chloro-3,6-difluoroanisole | 261762-37-2 | 2A-9077883 |
| 2-Chloro-5-fluorobenzylalcohol | 261762-59-8 | 2A-9077885 |
| 2-Chloro-6-fluoro-3-Methylphenylaceticacid | 261762-92-9 | 2A-9077886 |
| 3-Chloro-2-fluorophenylaceticacid | 261762-96-3 | 2A-9077887 |
| 3-Chloro-4-(trifluoromethoxy)benzylbromide | 261763-18-2 | 2A-9077889 |
| 5-(Benzyloxy)-2-(hydroxymethyl)pyridin-4-ol | 165948-37-8 | 2A-9077891 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA