
CAS Number261951-67-1
Synonyms1-(3-Fluoro-4-methylphenyl)methanamine; 1-(3-Fluoro-4-methylphenyl)methylamine; 3-Fluoro-4-methylbenzenemethanamine; 3-Fluoro-4-methylbenzylamine; (3-Fluoro-4-methylphenyl)methylamine; Z1R CF D1; 3-fluoro-4-methyl-benzylamine; MFCD01631531; (3-Fluoro-4-methylphenyl)methanamine; 4-methyl-3-fluorobenzylamine
Molecular FormulaC8H10N1F1
Molecular Weight139.17
Density1.1±0.1 g/cm3
Boiling Point198.0±25.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261951-67-1 |
| Catalog No. | 2A-9077899 |
| Chinese Name | 3-氟-4-甲基苄胺 |
| Synonyms | 1-(3-Fluoro-4-methylphenyl)methanamine; 1-(3-Fluoro-4-methylphenyl)methylamine; 3-Fluoro-4-methylbenzenemethanamine; 3-Fluoro-4-methylbenzylamine; (3-Fluoro-4-methylphenyl)methylamine; Z1R CF D1; 3-fluoro-4-methyl-benzylamine; MFCD01631531; (3-Fluoro-4-methylphenyl)methanamine; 4-methyl-3-fluorobenzylamine |
| Molecular Formula | C8H10N1F1 |
| Molecular Weight | 139.17 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 198.0±25.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| PubChem ID | 3210233 |
| MDL Number | MFCD01631531 |
| SMILES | Cc1ccc(CN)cc1F |
| InChI | InChI=1S/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| InChI Key | XCAJNBJDLZPHNB-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/77899_1_261951_67_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-6-fluoro-3-Methylphenylaceticacid | 261762-92-9 | 2A-9077886 |
| 3-Chloro-2-fluorophenylaceticacid | 261762-96-3 | 2A-9077887 |
| 3-Chloro-4-(trifluoromethoxy)benzylbromide | 261763-18-2 | 2A-9077889 |
| 5-(Benzyloxy)-2-(hydroxymethyl)pyridin-4-ol | 165948-37-8 | 2A-9077891 |
| 2,6-Difluoro-3-methylbenzylbromide | 261763-44-4 | 2A-9077893 |
| 4-Fluoro-3-methylbenzylamine | 261951-68-2 | 2A-9077900 |
| 3-Fluoro-4-Methylphenylaceticacid | 261951-74-0 | 2A-9077903 |
| 2-Methyl-4-(trifluoromethoxy)bromobenzene | 261951-96-6 | 2A-9077906 |
| Bis(2-diphenylphosphinophenyl)ether | 166330-10-5 | 2A-9077912 |
| N-[[L-trans-3-(Ethoxycarbonyl)oxiran-2-yl]carbonyl]-L-leucyl-3-(p-hydroxyphenyl)Ethylamide | 262381-84-0 | 2A-9077913 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA