
CAS Number161712-77-2
Synonyms5,6-difluoro-2,3-dihydro-1H-inden-1-one; 5,6-Difluoro-indan-1-one; 5,6-Difluor-2,3-dihydro-1H-inden-1-on; 5,6-difluoroindan-1-one; 5,6-bis(fluoranyl)-2,3-dihydroinden-1-one; 5,6-Difluoro-1-indanone; 5,6-Difluorindan-1-on; 1H-Inden-1-one,5,6-difluoro-2,3-dihydro; 5,6-Difluoro-indanone
Molecular FormulaC9H6F2O
Molecular Weight168.14
Density1.4±0.1 g/cm3
Boiling Point251.3±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 161712-77-2 |
| Catalog No. | 2A-9077694 |
| Chinese Name | 5,6-二氟-1-茚酮 |
| Synonyms | 5,6-difluoro-2,3-dihydro-1H-inden-1-one; 5,6-Difluoro-indan-1-one; 5,6-Difluor-2,3-dihydro-1H-inden-1-on; 5,6-difluoroindan-1-one; 5,6-bis(fluoranyl)-2,3-dihydroinden-1-one; 5,6-Difluoro-1-indanone; 5,6-Difluorindan-1-on; 1H-Inden-1-one,5,6-difluoro-2,3-dihydro; 5,6-Difluoro-indanone |
| Molecular Formula | C9H6F2O |
| Molecular Weight | 168.14 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 251.3±40.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 16877510 |
| SMILES | O=C1CCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C9H6F2O/c10-7-3-5-1-2-9(12)6(5)4-8(7)11/h3-4H,1-2H2 |
| InChI Key | OSJRTWXVMCRBKZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Fluoroquinolin-8-amine | 161038-18-2 | 2A-9077677 |
| 1-(4-Fluorophenyl)but-1-en-3-one | 1611-38-7 | 2A-9077681 |
| 2-Cyanoisonicotinicacid | 161233-97-2 | 2A-9077684 |
| 2-Iodo-4-methoxyphenylamine | 191348-14-8 | 2A-9077687 |
| 3-Chloro-4-fluorobenzylalcohol | 161446-90-8 | 2A-9077689 |
| 2-(1H-Indol-4-yl)aceticacid | 16176-74-2 | 2A-9077696 |
| 2-Methoxy-5-(trifluoromethoxy)benzoicacid | 191604-88-3 | 2A-9077699 |
| 1H-Pyrrol-1-ylaceticacid | 19167-98-7 | 2A-9077701 |
| 1-(3-Nitropyridin-4-yl)ethanone | 161871-65-4 | 2A-9077704 |
| C-thiazol-4-yl-methylamine | 16188-30-0 | 2A-9077705 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA