CAS Number161233-97-2
Synonyms2-Cyano-4-pyridine carboxylic acid; 2-cyanopyridine-4-carboxylic acid; 2-Cyanoisonicotinic acid
Molecular FormulaC7H4N2O2
Molecular Weight148.12
Density1.4±0.1 g/cm3
Boiling Point478.4±30.0 °C at 760 mmHg
Melting Point335 °C
AppearanceSolid;White to Light yellow powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 161233-97-2 |
| Catalog No. | 2A-9077684 |
| Chinese Name | 4-氰基吡啶-4-羧酸 |
| Synonyms | 2-Cyano-4-pyridine carboxylic acid; 2-cyanopyridine-4-carboxylic acid; 2-Cyanoisonicotinic acid |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 478.4±30.0 °C at 760 mmHg |
| Melting Point | 335 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | 2-8°C |
| HTC | 2933399090 |
| PubChem ID | 3190525 |
| SMILES | N#Cc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C7H4N2O2/c8-4-6-3-5(7(10)11)1-2-9-6/h1-3H,(H,10,11) |
| InChI Key | MPSVJNPESHZCIB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methyl-5-oxoprolinemethylester | 190783-99-4 | 2A-9077671 |
| 3,5-Dinitroisonicotinicacid | 191017-95-5 | 2A-9077674 |
| 1-Amino-3-benzyloxycyclobutane-1-carboxylicacid | 191110-50-6 | 2A-9077675 |
| 5-Fluoroquinolin-8-amine | 161038-18-2 | 2A-9077677 |
| 1-(4-Fluorophenyl)but-1-en-3-one | 1611-38-7 | 2A-9077681 |
| 2-Iodo-4-methoxyphenylamine | 191348-14-8 | 2A-9077687 |
| 3-Chloro-4-fluorobenzylalcohol | 161446-90-8 | 2A-9077689 |
| 5,6-Difluoro-1-indanone | 161712-77-2 | 2A-9077694 |
| 2-(1H-Indol-4-yl)aceticacid | 16176-74-2 | 2A-9077696 |
| 2-Methoxy-5-(trifluoromethoxy)benzoicacid | 191604-88-3 | 2A-9077699 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS