
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 161446-90-8 |
| Catalog No. | 2A-9077689 |
| Chinese Name | 3-氯-4-氟苯甲醇 |
| Synonyms | (3-Chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzenemethanol; MFCD01631550; Q1R CG DF |
| Molecular Formula | C7H6O1Cl1F1 |
| Molecular Weight | 160.58 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 242.5±25.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2906299090 |
| PubChem ID | 3208953 |
| MDL Number | MFCD01631550 |
| SMILES | OCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| InChI Key | KRQHBUXUXOPOON-UHFFFAOYSA-N |
| MSDS | msds/77689_1_161446_90_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Amino-3-benzyloxycyclobutane-1-carboxylicacid | 191110-50-6 | 2A-9077675 |
| 5-Fluoroquinolin-8-amine | 161038-18-2 | 2A-9077677 |
| 1-(4-Fluorophenyl)but-1-en-3-one | 1611-38-7 | 2A-9077681 |
| 2-Cyanoisonicotinicacid | 161233-97-2 | 2A-9077684 |
| 2-Iodo-4-methoxyphenylamine | 191348-14-8 | 2A-9077687 |
| 5,6-Difluoro-1-indanone | 161712-77-2 | 2A-9077694 |
| 2-(1H-Indol-4-yl)aceticacid | 16176-74-2 | 2A-9077696 |
| 2-Methoxy-5-(trifluoromethoxy)benzoicacid | 191604-88-3 | 2A-9077699 |
| 1H-Pyrrol-1-ylaceticacid | 19167-98-7 | 2A-9077701 |
| 1-(3-Nitropyridin-4-yl)ethanone | 161871-65-4 | 2A-9077704 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA