
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24455-93-4 |
| Catalog No. | 2A-9077456 |
| Chinese Name | N-(4-甲氧基苯基)乙二胺 |
| Synonyms | N-(2-aminoethyl)-N-(4-methoxy)amine; N-(4-methoxyphenyl)ethylenediamine |
| Molecular Formula | C9H14O1N2 |
| Molecular Weight | 166.22 |
| Density | 1.086g/cm3 |
| Boiling Point | 317.358ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 37456602 |
| MDL Number | MFCD06795942 |
| SMILES | COc1ccc(NCCN)cc1 |
| InChI | InChI=1S/C9H14N2O/c1-12-9-4-2-8(3-5-9)11-7-6-10/h2-5,11H,6-7,10H2,1H3 |
| InChI Key | LOEIZBNJCZKXFJ-UHFFFAOYSA-N |
| MSDS | msds/77456_1_24455_93_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl-4-iodo-3-hydroxybenzoate | 157942-12-6 | 2A-9077445 |
| Cyclobutyl-hydrazinehydrochloride | 158001-21-9 | 2A-9077446 |
| 6-Nitro-2-toluonitrile | 1885-76-3 | 2A-9077450 |
| 2-Amino-2'-fluorobenzophenone | 1581-13-1 | 2A-9077451 |
| 3,4-Dichloropyridin-2-amine | 188577-69-7 | 2A-9077453 |
| 9H-beta-carboline | 244-63-3 | 2A-9077458 |
| 2,5-Dibromoterephthalonitrile | 18870-11-6 | 2A-9077460 |
| 4,6-Dimethoxypyrimidin-5-amine | 15846-15-8 | 2A-9077462 |
| 3-(Aminomethyl)pyridin-4-amine | 158531-09-0 | 2A-9077464 |
| 4-Chloro-5-nitropyridin-2-amine | 24484-96-6 | 2A-9077466 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA