
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1581-13-1 |
| Catalog No. | 2A-9077451 |
| Chinese Name | 2-氨基-2-氟苯甲酮 |
| Synonyms | 2-Amino-2'-fluorobenzophenone; NRAJMXHXQHCBHO-UHFFFAOYSA; 2'-fluoro-2-aminobenzophenone |
| Molecular Formula | C13H10O1N1F1 |
| Molecular Weight | 215.23 |
| Density | 1.236g/cm3 |
| Boiling Point | 401.9ºC at 760mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, dry, protected from light |
| HTC | 2922399090 |
| PubChem ID | 3138352 |
| MDL Number | MFCD00007714 |
| SMILES | Nc1ccccc1C(=O)c1ccccc1F |
| InChI | InChI=1S/C13H10FNO/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8H,15H2 |
| InChI Key | NRAJMXHXQHCBHO-UHFFFAOYSA-N |
| MSDS | msds/77451_1_1581_13_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(1,3-Oxazol-5-yl)aniline | 157837-31-5 | 2A-9077438 |
| 3-Bromo-5-methoxybenzoicacid | 157893-14-6 | 2A-9077442 |
| Methyl-4-iodo-3-hydroxybenzoate | 157942-12-6 | 2A-9077445 |
| Cyclobutyl-hydrazinehydrochloride | 158001-21-9 | 2A-9077446 |
| 6-Nitro-2-toluonitrile | 1885-76-3 | 2A-9077450 |
| 3,4-Dichloropyridin-2-amine | 188577-69-7 | 2A-9077453 |
| N1-(4-methoxyphenyl)-1,2-Ethanediamine | 24455-93-4 | 2A-9077456 |
| 9H-beta-carboline | 244-63-3 | 2A-9077458 |
| 2,5-Dibromoterephthalonitrile | 18870-11-6 | 2A-9077460 |
| 4,6-Dimethoxypyrimidin-5-amine | 15846-15-8 | 2A-9077462 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA