
CAS Number18362-64-6
Synonyms2,6-dimethyl-3,5-heptadione; EINECS 242-234-8; Diisobutyrylmethane; 2,6-DiMethyl-3,5-heptanedione; MFCD00015040; 3,5-Heptanedione,2,6-dimethyl; 2,6-dimethylhepta-3,5-dione; 2,6-dimethyl-3,5-heptandione; 2,6-dimethylheptane-3,5-diketone
Molecular FormulaC9H16O2
Molecular Weight156.22
Density1.4586
Boiling Point66 °C (8 mmHg)
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18362-64-6 |
| Catalog No. | 2A-9077159 |
| Chinese Name | 2,6-二甲基-3,5-庚二酮 |
| Synonyms | 2,6-dimethyl-3,5-heptadione; EINECS 242-234-8; Diisobutyrylmethane; 2,6-DiMethyl-3,5-heptanedione; MFCD00015040; 3,5-Heptanedione,2,6-dimethyl; 2,6-dimethylhepta-3,5-dione; 2,6-dimethyl-3,5-heptandione; 2,6-dimethylheptane-3,5-diketone |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 |
| Density | 1.4586 |
| Boiling Point | 66 °C (8 mmHg) |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2914190090 |
| PubChem ID | 3156748 |
| MDL Number | MFCD00015040 |
| SMILES | CC(C)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h6-7H,5H2,1-4H3 |
| InChI Key | CEGGECULKVTYMM-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/77159_1_18362_64_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1224 Formal shipping name: Ketones, Liquid, Not otherwise specified. Packing grade: III 2,6-Dimethyl-3,5-heptanedione Modification number: 2 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-3-methylbutane | 18295-25-5 | 2A-9077146 |
| 2,3-Difluoro-6-bromobenzoicacid | 183065-72-7 | 2A-9077147 |
| 4,5-Difluoro-2-methylbenzoicacid | 183237-86-7 | 2A-9077150 |
| 3,4-Dimethyoxybenzenesulfonylchloride | 23095-31-0 | 2A-9077151 |
| 1-(3-Bromo-2-hydroxyphenyl)-ethanone | 1836-05-1 | 2A-9077158 |
| 2-Methyl-2-Ethyl-1-butanol | 18371-13-6 | 2A-9077163 |
| 4-(Methylsulfanyl)-2-nitroaniline | 23153-09-5 | 2A-9077167 |
| AcetonylmalonicacidDiethylester | 23193-18-2 | 2A-9077168 |
| 3,6-Dioxaoctanedioicacid | 23243-68-7 | 2A-9077170 |
| 2,3,5,6-Tetrafluoroanisole | 2324-98-3 | 2A-9077174 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA