
CAS Number183237-86-7
Synonyms4,5-Difluoro-2-methylbenzoicacid; MFCD08062377; 4,5-Difluoro-2-methylbenzoic acid; 3,4-Difluoro-6-methylbenzoic acid
Molecular FormulaC8H6F2O2
Molecular Weight172.13
Density1.4±0.1 g/cm3
Boiling Point268.9±35.0 °C at 760 mmHg
Melting Point119-121ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 183237-86-7 |
| Catalog No. | 2A-9077150 |
| Chinese Name | 4,5-二氟-2-甲基苯甲酸 |
| Synonyms | 4,5-Difluoro-2-methylbenzoicacid; MFCD08062377; 4,5-Difluoro-2-methylbenzoic acid; 3,4-Difluoro-6-methylbenzoic acid |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 268.9±35.0 °C at 760 mmHg |
| Melting Point | 119-121ºC |
| Appearance | powder |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| PubChem ID | 29318945 |
| SMILES | Cc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C8H6F2O2/c1-4-2-6(9)7(10)3-5(4)8(11)12/h2-3H,1H3,(H,11,12) |
| InChI Key | LDMHYYGJZWDBQL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2,2-Trifluoro-1-(4-hydroxyphenyl)ethanone | 1823-63-8 | 2A-9077139 |
| 1-[4-(Fluoromethoxy)phenyl]ethanone | 182678-46-2 | 2A-9077143 |
| 1-Cyclohexenylaceticacid | 18294-87-6 | 2A-9077145 |
| 2-Bromo-3-methylbutane | 18295-25-5 | 2A-9077146 |
| 2,3-Difluoro-6-bromobenzoicacid | 183065-72-7 | 2A-9077147 |
| 3,4-Dimethyoxybenzenesulfonylchloride | 23095-31-0 | 2A-9077151 |
| 1-(3-Bromo-2-hydroxyphenyl)-ethanone | 1836-05-1 | 2A-9077158 |
| 2,6-Dimethylheptane-3,5-dione | 18362-64-6 | 2A-9077159 |
| 2-Methyl-2-Ethyl-1-butanol | 18371-13-6 | 2A-9077163 |
| 4-(Methylsulfanyl)-2-nitroaniline | 23153-09-5 | 2A-9077167 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA