
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 148490-97-5 |
| Catalog No. | 2A-9076746 |
| Chinese Name | 4-碘-2-甲氧基苯甲酸甲酯 |
| Synonyms | methyl 4-iodo-2-methoxybenzoate |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 |
| Density | 1.801 g/cm3 |
| Boiling Point | 318ºC at 760 mmHg |
| Melting Point | 44-46 °C |
| Appearance | semi-solid |
| Storage Condition | 2-8°C, dry, protected from light |
| HTC | 2918990090 |
| PubChem ID | 39773558 |
| SMILES | COC(=O)c1ccc(I)cc1OC |
| InChI | InChI=1S/C9H9IO3/c1-12-8-5-6(10)3-4-7(8)9(11)13-2/h3-5H,1-2H3 |
| InChI Key | MCNOTXROWOGSGU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Dimethylamino)propanoicacid | 14788-12-6 | 2A-9076735 |
| 2-(3-(Benzyloxy)-4-methoxyphenyl)ethanaminehydrochloride | 148223-47-6 | 2A-9076737 |
| 5-Bromo-2-Chloro-4-fluorophenol | 148254-32-4 | 2A-9076739 |
| 2-Bromo-2-phenylacetophenone | 1484-50-0 | 2A-9076744 |
| Homopiperonylamine | 1484-85-1 | 2A-9076745 |
| Methyl4-bromo-3-methylbenzoate | 148547-19-7 | 2A-9076748 |
| 2,3-Dihydrobenzo[b][1,4]dioxine-5-carbonitrile | 148703-14-4 | 2A-9076751 |
| 1-[4-(2-AminoEthyl)piperazin-1-yl]ethanone | 148716-35-2 | 2A-9076752 |
| Ivabradinehydrochloride | 148849-67-6 | 2A-9076753 |
| 7-Trifluoromethoxyisatin | 149125-30-4 | 2A-9076758 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA