
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 148254-32-4 |
| Catalog No. | 2A-9076739 |
| Chinese Name | 5-溴-2-氯-4-氟苯酚 |
| Synonyms | 5-bromo-2-chloro-4-fluoro-phenol; 5-bromo-2-chloro-4-fluorphenol; 5-Bromo-2-chloro-4-fluorophenol; Phenol,5-bromo-2-chloro-4-fluoro |
| Molecular Formula | C6H3BrClFO |
| Molecular Weight | 225.44 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 240.7±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2908199090 |
| PubChem ID | 16546121 |
| SMILES | Oc1cc(Br)c(F)cc1Cl |
| InChI | InChI=1S/C6H3BrClFO/c7-3-1-6(10)4(8)2-5(3)9/h1-2,10H |
| InChI Key | NQQPSJDOZDIKTE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Dichlorophenylhydrazine | 14763-24-7 | 2A-9076728 |
| Benzo[b]thiophen-2-amine | 14770-79-7 | 2A-9076729 |
| 1,4-Diiodo-2-fluorobenzene | 147808-02-4 | 2A-9076732 |
| 3-(Dimethylamino)propanoicacid | 14788-12-6 | 2A-9076735 |
| 2-(3-(Benzyloxy)-4-methoxyphenyl)ethanaminehydrochloride | 148223-47-6 | 2A-9076737 |
| 2-Bromo-2-phenylacetophenone | 1484-50-0 | 2A-9076744 |
| Homopiperonylamine | 1484-85-1 | 2A-9076745 |
| Methyl4-iodo-2-methoxybenzoate | 148490-97-5 | 2A-9076746 |
| Methyl4-bromo-3-methylbenzoate | 148547-19-7 | 2A-9076748 |
| 2,3-Dihydrobenzo[b][1,4]dioxine-5-carbonitrile | 148703-14-4 | 2A-9076751 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA