
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2401-47-0 |
| Catalog No. | 2A-9070684 |
| Chinese Name | 2-(4-氯苯氧基)-N, N-二甲基乙胺 |
| Synonyms | I01-9578; [2-(4-Chlorphenoxy)-ethyl]-dimethylamin; N-<2-(4-Chlorphenoxy)-aethyl>-dimethylamin |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.67700 |
| Density | 1.096 g/cm3 |
| Boiling Point | 267 °C |
| Appearance | solid |
| Storage Condition | 2-8°C, dry |
| HTC | 2922299090 |
| PubChem ID | 7827338 |
| SMILES | CN(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H14ClNO/c1-12(2)7-8-13-10-5-3-9(11)4-6-10/h3-6H,7-8H2,1-2H3 |
| InChI Key | KKPXBCIAUAJAHE-UHFFFAOYSA-N |
| MSDS | msds/70684_1_2401_47_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-butyl5-(hydroxymethyl)pyridin-2-ylcarbamate | 169280-83-5 | 2A-9070677 |
| tert-butyl5-aminopyridin-2-ylcarbamate | 220731-04-4 | 2A-9070679 |
| 1-(4-(2-aminophenyl)piperazin-1-yl)ethanone | 91646-45-6 | 2A-9070680 |
| 2-(methylamino)-N-phenylacetamidehydrochloride | 60565-45-9 | 2A-9070681 |
| N-(4-ethoxyphenyl)-2-hydroxyacetamide | 22521-79-5 | 2A-9070682 |
| tert-butyl5-formylthiazol-2-ylcarbamate | 391668-77-2 | 2A-9070685 |
| 2-(4-methoxyphenoxy)-N,N-dimethylethanamine | 51344-12-8 | 2A-9070687 |
| tert-butyl6-(2-aminoethyl)pyridin-2-ylcarbamate | 400776-37-6 | 2A-9070688 |
| 3-hydroxy-N-p-tolylpropanamide | 199929-31-2 | 2A-9070691 |
| tert-butyl6-methylpyridin-2-ylcarbamate | 205676-84-2 | 2A-9070693 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA