
CAS Number51344-12-8
Synonyms[2-(4-methoxy-phenoxy)-ethyl]-dimethyl-amine; [2-(4-Methoxy-phenoxy)-aethyl]-dimethyl-amin; I01-9587; 4-Methoxy-1-(2-dimethylamino-aethoxy)-benzol; N,N-dimethyl-2-(4'-methoxyphenoxy)aminoethane; O-Methyl-O'-(2-dimethylamino-aethyl)-hydrochinon; 2-Dimethylamino-1-(4-methoxy-phenoxy)-aethan; Ethanamine,2-(4-methoxyphenoxy)-N,N-dimethyl
Molecular FormulaC11H17O2N1
Molecular Weight195.26
Density1.005 g/cm3
Boiling Point281 °C
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51344-12-8 |
| Catalog No. | 2A-9070687 |
| Chinese Name | 2-(4-甲氧基苯氧基)-N, N-二甲基乙胺 |
| Synonyms | [2-(4-methoxy-phenoxy)-ethyl]-dimethyl-amine; [2-(4-Methoxy-phenoxy)-aethyl]-dimethyl-amin; I01-9587; 4-Methoxy-1-(2-dimethylamino-aethoxy)-benzol; N,N-dimethyl-2-(4'-methoxyphenoxy)aminoethane; O-Methyl-O'-(2-dimethylamino-aethyl)-hydrochinon; 2-Dimethylamino-1-(4-methoxy-phenoxy)-aethan; Ethanamine,2-(4-methoxyphenoxy)-N,N-dimethyl |
| Molecular Formula | C11H17O2N1 |
| Molecular Weight | 195.26 |
| Density | 1.005 g/cm3 |
| Boiling Point | 281 °C |
| Appearance | liquid |
| Storage Condition | Room temperature, dry, inert gas |
| HTC | 2922299090 |
| PubChem ID | 42681117 |
| MDL Number | MFCD18800941 |
| SMILES | COc1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C11H17NO2/c1-12(2)8-9-14-11-6-4-10(13-3)5-7-11/h4-7H,8-9H2,1-3H3 |
| InChI Key | LTVRUDZZRDMXFX-UHFFFAOYSA-N |
| MSDS | msds/70687_1_51344_12_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-(2-aminophenyl)piperazin-1-yl)ethanone | 91646-45-6 | 2A-9070680 |
| 2-(methylamino)-N-phenylacetamidehydrochloride | 60565-45-9 | 2A-9070681 |
| N-(4-ethoxyphenyl)-2-hydroxyacetamide | 22521-79-5 | 2A-9070682 |
| 2-(4-chlorophenoxy)-N,N-dimethylethanamine | 2401-47-0 | 2A-9070684 |
| tert-butyl5-formylthiazol-2-ylcarbamate | 391668-77-2 | 2A-9070685 |
| tert-butyl6-(2-aminoethyl)pyridin-2-ylcarbamate | 400776-37-6 | 2A-9070688 |
| 3-hydroxy-N-p-tolylpropanamide | 199929-31-2 | 2A-9070691 |
| tert-butyl6-methylpyridin-2-ylcarbamate | 205676-84-2 | 2A-9070693 |
| N-(3,4-dichlorophenyl)-N-methylacetamide | 40233-28-1 | 2A-9070694 |
| 2,2-dimethoxy-N-phenylacetamide | 881-70-9 | 2A-9070696 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA