
CAS Number169280-83-5
SynonymsTERT-BUTYL [5-(HYDROXYMETHYL)PYRIDIN-2-YL)CARBAMATE; tert-butyl N-[5-(hydroxymethyl)pyridin-2-yl]carbamate; MFCD07186264; 2-(Boc-amino)-5-pyridinemethanol
Molecular FormulaC11H16N2O3
Molecular Weight224.26
Density1.209g/cm3
Boiling Point332.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 169280-83-5 |
| Catalog No. | 2A-9070677 |
| Chinese Name | 2-(Boc-氨基)-5-吡啶甲醇 |
| Synonyms | TERT-BUTYL [5-(HYDROXYMETHYL)PYRIDIN-2-YL)CARBAMATE; tert-butyl N-[5-(hydroxymethyl)pyridin-2-yl]carbamate; MFCD07186264; 2-(Boc-amino)-5-pyridinemethanol |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 |
| Density | 1.209g/cm3 |
| Boiling Point | 332.8ºC at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2933399090 |
| PubChem ID | 4846227 |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CO)cn1 |
| InChI | InChI=1S/C11H16N2O3/c1-11(2,3)16-10(15)13-9-5-4-8(7-14)6-12-9/h4-6,14H,7H2,1-3H3,(H,12,13,15) |
| InChI Key | BORDVYKLAFQRSP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzoicacid,3-amino-4-(1H-1,2,4-triazol-1-yl)-,methylester | 167626-50-8 | 2A-9070667 |
| tert-butyl4-oxocyclohexylcarbamate | 179321-49-4 | 2A-9070670 |
| Ethyl(3-chlorophenyl)carbamate | 2150-89-2 | 2A-9070674 |
| tert-butyl5-(aminomethyl)pyridin-2-ylcarbamate | 187237-37-2 | 2A-9070675 |
| 2-(4-aminophenyl)-N,N-dimethylacetamide | 81709-36-6 | 2A-9070676 |
| tert-butyl5-aminopyridin-2-ylcarbamate | 220731-04-4 | 2A-9070679 |
| 1-(4-(2-aminophenyl)piperazin-1-yl)ethanone | 91646-45-6 | 2A-9070680 |
| 2-(methylamino)-N-phenylacetamidehydrochloride | 60565-45-9 | 2A-9070681 |
| N-(4-ethoxyphenyl)-2-hydroxyacetamide | 22521-79-5 | 2A-9070682 |
| 2-(4-chlorophenoxy)-N,N-dimethylethanamine | 2401-47-0 | 2A-9070684 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA