
CAS Number129-91-9
Synonyms8-Amino-naphthalin-1,6-disulfonsaeure; MFCD00021548; 8-Aminonaphthalene-1,6-disulfonic acid; 1-Amino-3,8-disulfonaphthalene; 1-Naphthylamine-3,8-disulfonic acid; EINECS 204-969-2; 1-amino-3,8-naphthalenedisulfonic acid; 1,8-amino; Aminoepsilon acid; 8-Aminonaphthalene-1,6-disulphonic acid; 8-Amino-1,6-naphthalenedisulfonic acid; 8-amino-naphthalene-1,6-disulfonic acid
Molecular FormulaC10H9NO6S2
Molecular Weight303.312
Purity98%
Density1.8±0.1 g/cm3
Melting Point213-218°C
AppearanceOff-white crystalline powder with red color
EINECS204-969-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129-91-9 |
| Catalog No. | 2A-9007003 |
| Chinese Name | 8-氨基萘-1,6-二磺酸 |
| Synonyms | 8-Amino-naphthalin-1,6-disulfonsaeure; MFCD00021548; 8-Aminonaphthalene-1,6-disulfonic acid; 1-Amino-3,8-disulfonaphthalene; 1-Naphthylamine-3,8-disulfonic acid; EINECS 204-969-2; 1-amino-3,8-naphthalenedisulfonic acid; 1,8-amino; Aminoepsilon acid; 8-Aminonaphthalene-1,6-disulphonic acid; 8-Amino-1,6-naphthalenedisulfonic acid; 8-amino-naphthalene-1,6-disulfonic acid |
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.312 |
| Purity | 98 |
| Density | 1.8±0.1 g/cm3 |
| Melting Point | 213-218°C |
| Appearance | Off-white crystalline powder with red color |
| EINECS | 204-969-2 |
| HTC | 2921499090 |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cccc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C10H9NO6S2/c11-8-5-7(18(12,13)14)4-6-2-1-3-9(10(6)8)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17) |
| InChI Key | YDEOXZHCPCPPJG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Keto DHEA | 566-19-8 | 2A-9006981 |
| 7-Methoxy-1-tetralone | 6836-19-7 | 2A-9006983 |
| 7-O-(3-Bromopropyl)-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | 309252-38-8 | 2A-9006990 |
| 7-TMCA | 24209-38-9 | 2A-9006991 |
| 8-Acetyl-7-methyl-6H-1,2,5-oxadiazolo[3,4-e]indol-6-ol | 159325-84-5 | 2A-9007002 |
| 8-Br-cAMP Na | 76939-46-3 | 2A-9007008 |
| 8-Bromo-1-naphthoic acid | 1729-99-3 | 2A-9007009 |
| 8-Bromooctanoic acid | 17696-11-6 | 2A-0202021 |
| 8-Carboxy-3-methylflavone | 3468-01-7 | 2A-9007015 |
| 8-Chloro-10,11-dihydro-4-aza-5H-dibenzo-(a,d)cycloheptan-5-one | 31251-41-9 | 2A-9007016 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA