
CAS Number1729-99-3
Synonyms8-Bromo-1-naphthoic acid; 8-bromonaphthalene-1-carboxylic acid; MFCD00029357; EINECS 217-045-9
Molecular FormulaC11H7BrO2
Molecular Weight251.076
Purity97%
Density1.6±0.1 g/cm3
Boiling Point421.2±18.0 °C at 760 mmHg
Melting Point169-171ºC
EINECS217-045-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1729-99-3 |
| Catalog No. | 2A-9007009 |
| Chinese Name | 8-溴-1-萘甲酸 |
| Synonyms | 8-Bromo-1-naphthoic acid; 8-bromonaphthalene-1-carboxylic acid; MFCD00029357; EINECS 217-045-9 |
| Molecular Formula | C11H7BrO2 |
| Molecular Weight | 251.076 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 421.2±18.0 °C at 760 mmHg |
| Melting Point | 169-171ºC |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 217-045-9 |
| HTC | 2916399090 |
| SMILES | O=C(O)c1cccc2cccc(Br)c12 |
| InChI | InChI=1S/C11H7BrO2/c12-9-6-2-4-7-3-1-5-8(10(7)9)11(13)14/h1-6H,(H,13,14) |
| InChI Key | DMEZDDHJCUHENA-UHFFFAOYSA-N |
| Safety Description | S24/25 |
| MSDS | msds/7009_1_1729_99_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-O-(3-Bromopropyl)-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | 309252-38-8 | 2A-9006990 |
| 7-TMCA | 24209-38-9 | 2A-9006991 |
| 8-Acetyl-7-methyl-6H-1,2,5-oxadiazolo[3,4-e]indol-6-ol | 159325-84-5 | 2A-9007002 |
| 8-Amino-1,6-naphthalenedisulfonic acid sodium salt | 129-91-9 | 2A-9007003 |
| 8-Br-cAMP Na | 76939-46-3 | 2A-9007008 |
| 8-Bromooctanoic acid | 17696-11-6 | 2A-0202021 |
| 8-Carboxy-3-methylflavone | 3468-01-7 | 2A-9007015 |
| 8-Chloro-10,11-dihydro-4-aza-5H-dibenzo-(a,d)cycloheptan-5-one | 31251-41-9 | 2A-9007016 |
| 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]-diazepin-11-one | 50892-62-1 | 2A-9007018 |
| 8-Chloroquinaldine | 3033-82-7 | 2A-9007019 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA