CAS Number169507-61-3
SynonymsQVR BF DF EF CO2; 3-Ethoxy-2,4,5-trifluorobenzoic acid; 3-ethoxy-2,4,5-trifluoro-benzoic Acid; 2,3-DIHYDRO-1H-INDOLE-3-CARBOXYLIC ACID METHYL ESTER; 2,4,5-Trifluoro-3-ethoxy benzoic acid
Molecular FormulaC8H4O1N1F3
Molecular Weight187.12
Density1.4±0.1 g/cm3
Boiling Point297.4±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 169507-61-3 |
| Catalog No. | 2A-9069438 |
| Chinese Name | 2,4,5-三氟-3-乙氧基苯甲酸 |
| Synonyms | QVR BF DF EF CO2; 3-Ethoxy-2,4,5-trifluorobenzoic acid; 3-ethoxy-2,4,5-trifluoro-benzoic Acid; 2,3-DIHYDRO-1H-INDOLE-3-CARBOXYLIC ACID METHYL ESTER; 2,4,5-Trifluoro-3-ethoxy benzoic acid |
| Molecular Formula | C8H4O1N1F3 |
| Molecular Weight | 187.12 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 297.4±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| MDL Number | MFCD04115323 |
| SMILES | CCOc1c(F)c(F)cc(C(=O)O)c1F |
| InChI Key | HXAPHOPNZQFBEJ-UHFFFAOYSA-N |
| MSDS | msds/69438_1_169507_61_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-DibromoToluene | 31543-75-6 | 2A-9069199 |
| 2,4,5-Trifluorotoluene | 887267-34-7 | 2A-9069263 |
| Ethyl-2,4,5-trifluorobenzoylacetate | 207226-37-7 | 2A-9069265 |
| 2,4-Difluoro-3-hydroxybenzoicacid | 91659-08-4 | 2A-9069398 |
| 2,4-Difluoro-3-methylbenzoicacid | 112857-68-8 | 2A-9069401 |
| Trans-2,4-Difluorocinnamicacid | 94977-52-3 | 2A-9069441 |
| 2,4-Difluoro-6-nitroaniline | 364-30-7 | 2A-9069516 |
| 2,4,5-Trifluorobenzylchloride | 243139-71-1 | 2A-9069523 |
| 2,4-Dinitro-5-fluoroaniline | 367-81-7 | 2A-9069527 |
| 2,4-Difluorophenylisothiocyanate | 141106-52-7 | 2A-9069569 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS