CAS Number31543-75-6
Synonyms2,4-dibromo-1-methyl-benzene; EINECS 250-689-9; Benzene,2,4-dibromo-1-methyl; 2,4-Dibrom-toluol; 2,3-THIOEPOXY MADOL-D3; 2,4-Dibromotoluene; 2,3-dibromo-1-methylbenzene; 2,4-bromotoluene; 2,4-Dibromo-1-methylbenzene; MFCD00052985
Molecular FormulaC7H6Br2
Molecular Weight249.93
Density1.8±0.1 g/cm3
Boiling Point241.9±20.0 °C at 760 mmHg
Melting Point-10 °C
Appearancelight yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31543-75-6 |
| Catalog No. | 2A-9069199 |
| Chinese Name | 2,4-二溴甲苯 |
| Synonyms | 2,4-dibromo-1-methyl-benzene; EINECS 250-689-9; Benzene,2,4-dibromo-1-methyl; 2,4-Dibrom-toluol; 2,3-THIOEPOXY MADOL-D3; 2,4-Dibromotoluene; 2,3-dibromo-1-methylbenzene; 2,4-bromotoluene; 2,4-Dibromo-1-methylbenzene; MFCD00052985 |
| Molecular Formula | C7H6Br2 |
| Molecular Weight | 249.93 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 241.9±20.0 °C at 760 mmHg |
| Melting Point | -10 °C |
| Appearance | light yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2903999090 |
| MDL Number | MFCD00052985 |
| SMILES | Cc1ccc(Br)cc1Br |
| InChI | InChI=1S/C7H6Br2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChI Key | GHWYNNFPUGEYEM-UHFFFAOYSA-N |
| MSDS | msds/69199_1_31543_75_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,4-Dibromotoluene Modification number: 5 |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Ethyl2,4-dihydroxyphenylacetate | 67828-62-0 | 2A-9068944 |
| 2,4-dibromo-3,5-dimethylthiophene | 63862-00-0 | 2A-9069054 |
| 2,4-dimethylthiophene | 638-00-6 | 2A-9069057 |
| 2,4-Dicyanobenzotrifluoride | 1483-43-8 | 2A-9069105 |
| 2,4-Dimethyl-5-nitrobenzotrifluoride | 261945-82-8 | 2A-9069147 |
| 2,4,5-Trifluorotoluene | 887267-34-7 | 2A-9069263 |
| Ethyl-2,4,5-trifluorobenzoylacetate | 207226-37-7 | 2A-9069265 |
| 2,4-Difluoro-3-hydroxybenzoicacid | 91659-08-4 | 2A-9069398 |
| 2,4-Difluoro-3-methylbenzoicacid | 112857-68-8 | 2A-9069401 |
| 2,4,5-Trifluoro-3-ethoxybenzoicacid | 169507-61-3 | 2A-9069438 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS