
CAS Number367-81-7
SynonymsEINECS 206-700-4; 2,4-DINITRO-5-FLUOROANILINE; MFCD00007150; bergmann's reagent; 5-Fluoro-2,4-dinitroaniline; N-(TriphenylMethyl)-L-serine Methyl Ester
Molecular FormulaC6H4N1Br2F1
Molecular Weight268.91
Density1.7±0.1 g/cm3
Boiling Point425.0±40.0 °C at 760 mmHg
Melting Point185-190 °C(lit.)
Appearanceyellow powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 367-81-7 |
| Catalog No. | 2A-9069527 |
| Chinese Name | 2,4-二硝基-5-氟苯胺 |
| Synonyms | EINECS 206-700-4; 2,4-DINITRO-5-FLUOROANILINE; MFCD00007150; bergmann's reagent; 5-Fluoro-2,4-dinitroaniline; N-(TriphenylMethyl)-L-serine Methyl Ester |
| Molecular Formula | C6H4N1Br2F1 |
| Molecular Weight | 268.91 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 425.0±40.0 °C at 760 mmHg |
| Melting Point | 185-190 °C(lit.) |
| Appearance | yellow powder |
| Storage Condition | It should be sealed with argon gas and stored in a |
| Packaging | III |
| HTC | 2921420090 |
| MDL Number | MFCD09878124 |
| SMILES | Nc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4FN3O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H,8H2 |
| InChI Key | RAGRTYREMCPEIV-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/69527_1_367_81_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 2811 Proper Shipping Name: Toxic Solid, Organic, Not Otherwise Specified Packing grade: III |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Difluoro-3-methylbenzoicacid | 112857-68-8 | 2A-9069401 |
| 2,4,5-Trifluoro-3-ethoxybenzoicacid | 169507-61-3 | 2A-9069438 |
| Trans-2,4-Difluorocinnamicacid | 94977-52-3 | 2A-9069441 |
| 2,4-Difluoro-6-nitroaniline | 364-30-7 | 2A-9069516 |
| 2,4,5-Trifluorobenzylchloride | 243139-71-1 | 2A-9069523 |
| 2,4-Difluorophenylisothiocyanate | 141106-52-7 | 2A-9069569 |
| 2,4-dibromo-3-nitropyridine | 121263-10-3 | 2A-9069580 |
| 2,4-dichloro-6-methylpyrimidin-5-amine | 13162-27-1 | 2A-9069583 |
| 2,4-dimethoxybenzamidinehydrochloride | 131947-81-4 | 2A-9069587 |
| 2,4,5-TrifluoroBenzaldehyde | 165407-24-5 | 2A-9069660 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA