| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51484-06-1 |
| Catalog No. | 2A-9006763 |
| Chinese Name | 6-溴色酮-2-甲酸 |
| Synonyms | MFCD01242619; 6-bromochromone-2-carboxylic acid |
| Molecular Formula | C10H5BrO4 |
| Molecular Weight | 269.04800 |
| Purity | 98 |
| Density | 1.874g/cm3 |
| Boiling Point | 397.8ºC at 760 mmHg |
| Melting Point | ~265 °C (dec.)(lit.) |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Soluble in: dimethylformamide |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2918300090 |
| SMILES | O=C(O)c1cc(=O)c2cc(Br)ccc2o1 |
| InChI Key | QSBZDBNPXSVVHH-UHFFFAOYSA-N |
| MSDS | msds/6763_1_51484_06_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6,8-Dichlorochromone-3-carboxylic acid | 2A-106678 | 2A-9006678 |
| 6-[3-(1-Adamantyl)-4-hydroxyphenyl]-2-naphthalenecarboxylic acid | 2A-106680 | 2A-9006680 |
| 6-Benzoyl-cyclohex-3-enecarboxylic acid | 31211-31-1 | 2A-9006697 |
| 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylicacid hydrazide | 2A-106749 | 2A-9006749 |
| 6-Bromobenzo[1,3]dioxole-5-carbaldehyde | 15930-53-7 | 2A-9006758 |
| 6-Bromochromone-3-carboxylic acid | 51085-91-7 | 2A-9006764 |
| 6-Chloro-2-fluoro-3-methylbenzaldehyde | 286474-59-7 | 2A-9006776 |
| 6-Chloro-4-hydroxy-2-methyl-1,1-dioxo-2,5-dihydro-1H-1l6-cyclopenta[e][1,2]thiazine-3-carboxylic acid pyridin-2-ylamide | 2A-106788 | 2A-9006788 |
| 6-Chlorochromone-2-carboxylic acid | 5006-45-1 | 2A-9006800 |
| 6-Chlorochromone-3-carboxylic acid | 51085-92-8 | 2A-9006801 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS