
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5006-45-1 |
| Catalog No. | 2A-9006800 |
| Chinese Name | 6-氯色酮-2-甲酸 |
| Synonyms | MFCD00847039; 6-chloro-4-oxochromene-2-carboxylic acid |
| Molecular Formula | C10H5ClO4 |
| Molecular Weight | 224.59700 |
| Purity | 98 |
| Density | 1.612g/cm3 |
| Boiling Point | 384.5ºC at 760 mmHg |
| Melting Point | 254-256ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Room Temperature |
| HTC | 2918300090 |
| SMILES | [O-]C(=O)C1=CC(=O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C10H5ClO4/c11-5-1-2-8-6(3-5)7(12)4-9(15-8)10(13)14/h1-4H,(H,13,14)/p-1 |
| InChI Key | InChIKey=HALQFUWRVXLBIS-UHFFFAOYSA-M |
| MSDS | msds/6800_1_5006_45_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-Bromobenzo[1,3]dioxole-5-carbaldehyde | 15930-53-7 | 2A-9006758 |
| 6-Bromochromone-2-carboxylic acid | 51484-06-1 | 2A-9006763 |
| 6-Bromochromone-3-carboxylic acid | 51085-91-7 | 2A-9006764 |
| 6-Chloro-2-fluoro-3-methylbenzaldehyde | 286474-59-7 | 2A-9006776 |
| 6-Chloro-4-hydroxy-2-methyl-1,1-dioxo-2,5-dihydro-1H-1l6-cyclopenta[e][1,2]thiazine-3-carboxylic acid pyridin-2-ylamide | 2A-106788 | 2A-9006788 |
| 6-Chlorochromone-3-carboxylic acid | 51085-92-8 | 2A-9006801 |
| 6-Fluoro-2-iodobenzaldehyde | 2A-106824 | 2A-9006824 |
| 6-Fluorochromone-2-carboxylic acid | 99199-59-4 | 2A-9006828 |
| 6-Hydroxy-2-naphthaldehyde | 78119-82-1 | 2A-9006840 |
| 6-Hydroxy-2-naphthaleneboronic acid | 173194-95-1 | 2A-9006841 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA