
CAS Number31211-31-1
Synonyms(±)-cis-6-benzoylcyclohex-3-enecarboxylic acid; racemic cis-6-benzoylcyclohex-3-enecarboxylic acid; (+-)-cis-2-Benzoyl-cyclohexen-(4)-carbonsaeure-(1); cis-2-benzoylcyclohex-4-enecarboxylic acid; 6-Benzoylcyclohex-3-enecarboxylic acid; (+-)-cis-2-benzoyl-cyclohexene-(4)-carboxylic acid-(1)
Molecular FormulaC14H14O3
Molecular Weight230.266
Purity98%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31211-31-1 |
| Catalog No. | 2A-9006697 |
| Chinese Name | 6-苯甲酰基环己烯-3-羧酸 |
| Synonyms | (±)-cis-6-benzoylcyclohex-3-enecarboxylic acid; racemic cis-6-benzoylcyclohex-3-enecarboxylic acid; (+-)-cis-2-Benzoyl-cyclohexen-(4)-carbonsaeure-(1); cis-2-benzoylcyclohex-4-enecarboxylic acid; 6-Benzoylcyclohex-3-enecarboxylic acid; (+-)-cis-2-benzoyl-cyclohexene-(4)-carboxylic acid-(1) |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.266 |
| Purity | 98 |
| HTC | 2918300090 |
| MDL Number | MFCD01026063 |
| SMILES | O=C(O)C1CC=CCC1C(=O)c1ccccc1 |
| InChI Key | JJALHZDTTJJYCI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-(Chloromethyl)uracil | 18592-13-7 | 2A-9006662 |
| 6,3-Glucuronolactone acetonide | 2A-106664 | 2A-9006664 |
| 6,8-Dichlorochromone-2-carboxylic acid | 16722-38-6 | 2A-9006677 |
| 6,8-Dichlorochromone-3-carboxylic acid | 2A-106678 | 2A-9006678 |
| 6-[3-(1-Adamantyl)-4-hydroxyphenyl]-2-naphthalenecarboxylic acid | 2A-106680 | 2A-9006680 |
| 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylicacid hydrazide | 2A-106749 | 2A-9006749 |
| 6-Bromobenzo[1,3]dioxole-5-carbaldehyde | 15930-53-7 | 2A-9006758 |
| 6-Bromochromone-2-carboxylic acid | 51484-06-1 | 2A-9006763 |
| 6-Bromochromone-3-carboxylic acid | 51085-91-7 | 2A-9006764 |
| 6-Chloro-2-fluoro-3-methylbenzaldehyde | 286474-59-7 | 2A-9006776 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA