
CAS Number3764-94-1
SynonymsEINECS 223-184-6; 5-chlorotryptamine; 2-(5-Chloro-1H-indol-3-yl)ethanamine; MFCD00051990
Molecular FormulaC10H11ClN2
Molecular Weight194.661
Purity98%
Density1.3±0.1 g/cm3
Boiling Point375.7±27.0 °C at 760 mmHg
Melting Point120℃
AppearanceYellow to brown viscous oil or semi-solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3764-94-1 |
| Catalog No. | 2A-9006490 |
| Chinese Name | 5-氯靛胺盐酸盐 |
| Synonyms | EINECS 223-184-6; 5-chlorotryptamine; 2-(5-Chloro-1H-indol-3-yl)ethanamine; MFCD00051990 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.661 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 375.7±27.0 °C at 760 mmHg |
| Melting Point | 120℃ |
| Appearance | Yellow to brown viscous oil or semi-solid |
| Storage Condition | 2-8°C |
| HTC | 2933990090 |
| SMILES | NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H11ClN2/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6,13H,3-4,12H2 |
| InChI Key | FVQKQPVVCKOWLM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloroethyl-6-chloro-1,3-dihydro-1H-indol-2-one | 118289-55-7 | 2A-9006473 |
| 5-Chloronicotinic acid | 22620-27-5 | 2A-9006482 |
| 5-Chlorosalicyl alcohol | 5330-38-1 | 2A-9006485 |
| 5-Chlorosalicylamide | 7120-43-6 | 2A-9006487 |
| 5-Chlorosulfonyl-2-hydroxybenzoic acid | 17243-13-9 | 2A-9006488 |
| 5-Chlorouracil | 1820-81-1 | 2A-9006491 |
| 5-Cyano-2,8-dimethyl-5-non-2,7-dienoic acid | 189640-37-7 | 2A-9006493 |
| 5-Cyano-5H-dibenzo(b,f)azepine | 42787-75-7 | 2A-9006496 |
| 5-Cyano-6-cyclohexyl-2-thiouracil | 290313-19-8 | 2A-9006497 |
| 5-Cyanophthalide | 82104-74-3 | 2A-9006499 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA