
CAS Number5330-38-1
Synonyms5-Chlorosalicyl alcohol; 5-Chlor-2-hydroxy-benzylalkohol; EINECS 226-225-6; 4-chloro-2-hydroxymethylphenol; MFCD00021967; 5-chlorosaligenin; 5-chloro-2-hydroxy-benzyl alcohol; Saligenin,5-chloro; Benzenemethanol,5-chloro-2-hydroxy; 2-hydroxymethyl-4-chlorophenol
Molecular FormulaC7H7ClO2
Molecular Weight158.58200
Purity98%
Density1.395g/cm3
Boiling Point258.2ºC at 760mmHg
Melting Point90ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5330-38-1 |
| Catalog No. | 2A-9006485 |
| Chinese Name | 5-氯-2-羟基苯甲醇 |
| Synonyms | 5-Chlorosalicyl alcohol; 5-Chlor-2-hydroxy-benzylalkohol; EINECS 226-225-6; 4-chloro-2-hydroxymethylphenol; MFCD00021967; 5-chlorosaligenin; 5-chloro-2-hydroxy-benzyl alcohol; Saligenin,5-chloro; Benzenemethanol,5-chloro-2-hydroxy; 2-hydroxymethyl-4-chlorophenol |
| Molecular Formula | C7H7ClO2 |
| Molecular Weight | 158.58200 |
| Purity | 98 |
| Density | 1.395g/cm3 |
| Boiling Point | 258.2ºC at 760mmHg |
| Melting Point | 90ºC |
| Storage Condition | Room Temperature |
| HTC | 2908199090 |
| SMILES | OCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C7H7ClO2/c8-6-1-2-7(10)5(3-6)4-9/h1-3,9-10H,4H2 |
| InChI Key | AFPSETMCMFRVPG-UHFFFAOYSA-N |
| MSDS | msds/6485_1_5330_38_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-7-methylisatin | 14389-06-1 | 2A-9006466 |
| 5-Chloroacetamido-6-methyluracil | 27870-38-8 | 2A-9006467 |
| 5-Chlorobenzothiazolone | 20600-44-6 | 2A-9006469 |
| 5-Chloroethyl-6-chloro-1,3-dihydro-1H-indol-2-one | 118289-55-7 | 2A-9006473 |
| 5-Chloronicotinic acid | 22620-27-5 | 2A-9006482 |
| 5-Chlorosalicylamide | 7120-43-6 | 2A-9006487 |
| 5-Chlorosulfonyl-2-hydroxybenzoic acid | 17243-13-9 | 2A-9006488 |
| 5-Chlorotryptamine | 3764-94-1 | 2A-9006490 |
| 5-Chlorouracil | 1820-81-1 | 2A-9006491 |
| 5-Cyano-2,8-dimethyl-5-non-2,7-dienoic acid | 189640-37-7 | 2A-9006493 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA