
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3506-81-8 |
| Catalog No. | 2A-9064802 |
| Chinese Name | 4-(3-硝基苯基)丁-2-酮 |
| Synonyms | 4-(3-nitrophenyl)-2-butanone; 3-Nitro-benzylaceton; m-Nitrobenzylaceton |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.445 |
| Density | 1.176g/cm3 |
| Boiling Point | 321.2ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| MDL Number | MFCD09266050 |
| SMILES | CC(=O)CCc1cccc([N+](=O)[O-])c1 |
| InChI Key | VYVUFYWGUYOWTO-UHFFFAOYSA-N |
| MSDS | msds/64802_1_3506_81_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(o-Bromophenyl)-2-butanone | 3506-68-1 | 2A-9064797 |
| 4-(m-Bromophenyl)-2-butanone | 3506-70-5 | 2A-9064798 |
| 4-(o-Chlorophenyl)-2-butanone | 3506-72-7 | 2A-9064799 |
| 4-(m-Chlorophenyl)-2-butanone | 3506-73-8 | 2A-9064800 |
| 4-(m-Fluorophenyl)-2-butanone | 3506-77-2 | 2A-9064801 |
| 4-(a-Naphthyl)-2-butanone | 3506-84-1 | 2A-9064803 |
| 1-Phenyl-1,4-pentanedione | 583-05-1 | 2A-9064804 |
| Methyl phenyl sulfoxide | 1193-82-4 | 2A-9064805 |
| Methyl 4-ketopentyl sulfoxide | 13921-21-6 | 2A-9064806 |
| Thian 1-oxide | 4988-34-5 | 2A-9064807 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA