
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3506-68-1 |
| Catalog No. | 2A-9064797 |
| Chinese Name | 4-(2-bromophenyl)butan-2-one |
| Synonyms | 4-(2-bromo-phenyl)-but-2-one; 4-(2-bromophenyl)-2-butanone; 2-Brom-benzylaceton; 4-(o-Bromphenyl)-butan-2-on; 4-(o-Bromophenyl)-2-butanone |
| Molecular Formula | C19H17BrClN3S |
| Molecular Weight | 434.788 |
| Density | 1.347g/cm3 |
| Boiling Point | 280.7ºC at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD09266053 |
| SMILES | CC(=O)CCc1ccccc1Br |
| InChI | InChI=1S/C10H11BrO/c1-8(12)6-7-9-4-2-3-5-10(9)11/h2-5H,6-7H2,1H3 |
| InChI Key | NBYZNXNQBDMMAJ-UHFFFAOYSA-N |
| MSDS | msds/64797_1_3506_68_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethyl isonitrosomalonate | 6829-41-0 | 2A-9064789 |
| 2,6-Dimethyl-3,5-diphenyl-4H-pyran-4-one | 33731-54-3 | 2A-9064790 |
| Ethyl cyclohexylideneacetate | 1552-92-7 | 2A-9064791 |
| Benzene, iodoso- | 536-80-1 | 2A-9064793 |
| 5-Methylene-2-hexanone | 3240-09-3 | 2A-9064796 |
| 4-(m-Bromophenyl)-2-butanone | 3506-70-5 | 2A-9064798 |
| 4-(o-Chlorophenyl)-2-butanone | 3506-72-7 | 2A-9064799 |
| 4-(m-Chlorophenyl)-2-butanone | 3506-73-8 | 2A-9064800 |
| 4-(m-Fluorophenyl)-2-butanone | 3506-77-2 | 2A-9064801 |
| 4-(m-Nitrophenyl)-2-butanone | 3506-81-8 | 2A-9064802 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA