
CAS Number583-05-1
Synonyms1-Phenyl-1,4-pentanedione; 1-phenyl-1,4-pentandione; 1,4-Pentanedione,1-phenyl; 1-Phenyl-pentane-1,4-dione; 1-phenyl-1,4-pentadione; 1,4-dioxo-1-phenyl-pentane; MFCD00092889; 1-phenylpentane-1,4-dione
Molecular FormulaC11H12O2
Molecular Weight176.217
Density1.1±0.1 g/cm3
Boiling Point305.8±25.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 583-05-1 |
| Catalog No. | 2A-9064804 |
| Chinese Name | 1-苯基-1,4-戊二酮 |
| Synonyms | 1-Phenyl-1,4-pentanedione; 1-phenyl-1,4-pentandione; 1,4-Pentanedione,1-phenyl; 1-Phenyl-pentane-1,4-dione; 1-phenyl-1,4-pentadione; 1,4-dioxo-1-phenyl-pentane; MFCD00092889; 1-phenylpentane-1,4-dione |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.217 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 305.8±25.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2914399090 |
| MDL Number | MFCD00092889 |
| SMILES | CC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-9(12)7-8-11(13)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChI Key | RBLXWIPBPPVLPU-UHFFFAOYSA-N |
| MSDS | msds/64804_1_583_05_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(o-Chlorophenyl)-2-butanone | 3506-72-7 | 2A-9064799 |
| 4-(m-Chlorophenyl)-2-butanone | 3506-73-8 | 2A-9064800 |
| 4-(m-Fluorophenyl)-2-butanone | 3506-77-2 | 2A-9064801 |
| 4-(m-Nitrophenyl)-2-butanone | 3506-81-8 | 2A-9064802 |
| 4-(a-Naphthyl)-2-butanone | 3506-84-1 | 2A-9064803 |
| Methyl phenyl sulfoxide | 1193-82-4 | 2A-9064805 |
| Methyl 4-ketopentyl sulfoxide | 13921-21-6 | 2A-9064806 |
| Thian 1-oxide | 4988-34-5 | 2A-9064807 |
| 1,4-Oxathiane, 4-oxide | 109-03-5 | 2A-9064808 |
| Bis(2-diethylaminoethyl)sulfoxide | 39769-91-0 | 2A-9064809 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA