
CAS Number20876-29-3
Synonyms2-Nitro-5-methoxy-phenylessigsaeure; 5-methoxy-2-nitrophenyl-acetic acid; 5-methoxy-2-nitrobenzene-acetic acid; 5-Methoxy-2-nitrophenyl acetic acid; (5-Methoxy-2-nitro-phenyl)-essigsaeure; Benzeneaceticacid,5-methoxy-2-nitro; (5-Methoxy-2-nitrophenyl)acetic acid
Molecular FormulaC9H9NO5
Molecular Weight219.24
Purity98%
Density1.4±0.1 g/cm3
Boiling Point404.7±30.0 °C at 760 mmHg
Melting Point161-163 °C (lit.)
EINECS220-734-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20876-29-3 |
| Catalog No. | 2A-9063932 |
| Chinese Name | 2-硝基-5-甲氧基苯乙酸 |
| Synonyms | 2-Nitro-5-methoxy-phenylessigsaeure; 5-methoxy-2-nitrophenyl-acetic acid; 5-methoxy-2-nitrobenzene-acetic acid; 5-Methoxy-2-nitrophenyl acetic acid; (5-Methoxy-2-nitro-phenyl)-essigsaeure; Benzeneaceticacid,5-methoxy-2-nitro; (5-Methoxy-2-nitrophenyl)acetic acid |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 219.24 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 404.7±30.0 °C at 760 mmHg |
| Melting Point | 161-163 °C (lit.) |
| Storage Condition | room temperature, dry |
| EINECS | 220-734-7 |
| HTC | 2918990090 |
| PubChem ID | 24846692 |
| MDL Number | MFCD00005618 |
| SMILES | COc1ccc2[nH]c(C)c(CC(O)=O)c2c1 |
| InChI | 1S/C12H13NO3/c1-7-9(6-12(14)15)10-5-8(16-2)3-4-11(10)13-7/h3-5,13H,6H2,1-2H3,(H,14,15) |
| InChI Key | TXWGINUZLBAKDF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/63932_1_20876_29_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Triazene, 1,3-diphenyl- | 136-35-6 | 2A-9063926 |
| 2-Cyclopentene-1-acetamide | 72845-09-1 | 2A-9063927 |
| 1-Hydroxy-2-methylpent-1-en-3-one | 50421-81-3 | 2A-9063929 |
| 2-Methylene-1,3-dithiolane | 26728-22-3 | 2A-9063930 |
| Aniline, 2,6-diiodo-4-nitro- | 5398-27-6 | 2A-9063931 |
| Hydrazine, 1,2-dimethyl-, dihydrochloride | 306-37-6 | 2A-9063933 |
| Hydrazine, 1,1-dimethyl-, hydrochloride | 593-82-8 | 2A-9063935 |
| Benzene, (3,3-dimethyl-1-butenyl)- (E)- | 3846-66-0 | 2A-9063936 |
| 1,4-Diphenylbutadiene | 886-65-7 | 2A-9063937 |
| Propiophenone, b,b-diphenyl- | 606-86-0 | 2A-9063938 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA