
CAS Number136-35-6
SynonymsBenzene azoanilide; DAAB; cellofor(czech); Diazoaraino benzene; Diazoaminobenzol; Cellofor; benzeneazoaniline; MFCD00003021; Diazoaminobenzene; trans-1,3-diphenyltriazene; Diazoaminobenzen; phenylazoaminobenzene; (E)-1,3-diphenyltriaz-1-ene; EINECS 205-240-1; 1,3-diphenyl-1-triazene; anilinoazobenzene
Molecular FormulaC12H11N3
Molecular Weight197.23600
Density1.07 g/cm3
Boiling Point304.9ºC at 760 mmHg
Melting Point96°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 136-35-6 |
| Catalog No. | 2A-9063926 |
| Chinese Name | 苯氨基重氮苯 |
| Synonyms | Benzene azoanilide; DAAB; cellofor(czech); Diazoaraino benzene; Diazoaminobenzol; Cellofor; benzeneazoaniline; MFCD00003021; Diazoaminobenzene; trans-1,3-diphenyltriazene; Diazoaminobenzen; phenylazoaminobenzene; (E)-1,3-diphenyltriaz-1-ene; EINECS 205-240-1; 1,3-diphenyl-1-triazene; anilinoazobenzene |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.23600 |
| Density | 1.07 g/cm3 |
| Boiling Point | 304.9ºC at 760 mmHg |
| Melting Point | 96°C |
| Storage Condition | It should be sealed and stored in a ventilated, co |
| HTC | 2928000090 |
| UN(IATA) | UN 无资料 |
| SMILES | c1ccc(N=NNc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N3/c1-3-7-11(8-4-1)13-15-14-12-9-5-2-6-10-12/h1-10H,(H,13,14) |
| InChI Key | ALIFPGGMJDWMJH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Phthalide, 3-benzylidene- | 575-61-1 | 2A-9063914 |
| Sulfide, b-chloroethyl methyl | 542-81-4 | 2A-9063916 |
| 2-Amino-3,3-diphenyl-1-cyclopentene-1-carbonitrile | 3597-67-9 | 2A-9063922 |
| 2,2-Diphenylcyclopentanone | 15324-42-2 | 2A-9063923 |
| Octadecamethylene glycol | 3155-43-9 | 2A-9063925 |
| 2-Cyclopentene-1-acetamide | 72845-09-1 | 2A-9063927 |
| 1-Hydroxy-2-methylpent-1-en-3-one | 50421-81-3 | 2A-9063929 |
| 2-Methylene-1,3-dithiolane | 26728-22-3 | 2A-9063930 |
| Aniline, 2,6-diiodo-4-nitro- | 5398-27-6 | 2A-9063931 |
| 5-Methoxy-2-nitrophenylacetic acid | 20876-29-3 | 2A-9063932 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA