
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 593-82-8 |
| Catalog No. | 2A-9063935 |
| Chinese Name | 1,1-二甲基肼盐酸盐 |
| Synonyms | 1,1-dimethylhydrazine,hydrochloride |
| Molecular Formula | C2H9N2Cl1 |
| Molecular Weight | 96.56 |
| Density | 0.829g/cm3 |
| Boiling Point | 63.9ºC at 760mmHg |
| Melting Point | 85ºC |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | almost transparency |
| Storage Condition | Store in inert gas; avoid air, moisture (hygroscop |
| Packaging | III |
| HTC | 2928000090 |
| MDL Number | MFCD00060207 |
| SMILES | CN(C)N.Cl |
| InChI | InChI=1S/C2H8N2.ClH/c1-4(2)3;/h3H2,1-2H3;1H |
| InChI Key | VFQADAFGYKTPSH-UHFFFAOYSA-N |
| Hazard Symbols | 3.0 |
| MSDS | msds/63935_1_593_82_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 2811 Proper Shipping Name: Toxic Solid, Organic, Not Otherwise Specified Packing grade: III Marine pollutants: Y 1,1-Dimethylhydrazine hydrochloride Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Hydroxy-2-methylpent-1-en-3-one | 50421-81-3 | 2A-9063929 |
| 2-Methylene-1,3-dithiolane | 26728-22-3 | 2A-9063930 |
| Aniline, 2,6-diiodo-4-nitro- | 5398-27-6 | 2A-9063931 |
| 5-Methoxy-2-nitrophenylacetic acid | 20876-29-3 | 2A-9063932 |
| Hydrazine, 1,2-dimethyl-, dihydrochloride | 306-37-6 | 2A-9063933 |
| Benzene, (3,3-dimethyl-1-butenyl)- (E)- | 3846-66-0 | 2A-9063936 |
| 1,4-Diphenylbutadiene | 886-65-7 | 2A-9063937 |
| Propiophenone, b,b-diphenyl- | 606-86-0 | 2A-9063938 |
| Phenyl selenide | 1132-39-4 | 2A-9063940 |
| (4,4-Dibromobut-3-enyl)benzene | 119405-97-9 | 2A-9063941 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA