
CAS Number10547-60-1
Synonyms4-methoxy-4'-chlorobenzophenone; p-anisyl p-chlorophenyl ketone; 4-Chloro-4'-methoxybenzophenone; p-Anisophenone,4'-chloro
Molecular FormulaC14H11ClO2
Molecular Weight246.7
Density1.212g/cm3
Boiling Point380.5ºC at 760mmHg
Melting Point124-125 °C(Predicted)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10547-60-1 |
| Catalog No. | 2A-9062228 |
| Chinese Name | 4-(4-氯苯甲酰基)苯甲醚 |
| Synonyms | 4-methoxy-4'-chlorobenzophenone; p-anisyl p-chlorophenyl ketone; 4-Chloro-4'-methoxybenzophenone; p-Anisophenone,4'-chloro |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.7 |
| Density | 1.212g/cm3 |
| Boiling Point | 380.5ºC at 760mmHg |
| Melting Point | 124-125 °C(Predicted) |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| MDL Number | MFCD01105071 |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H11ClO2/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3 |
| InChI Key | JJVJYPSXZCEIEQ-UHFFFAOYSA-N |
| MSDS | msds/62228_1_10547_60_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Propanone, 2-chloro-1-(4-chlorophenyl)- | 877-38-3 | 2A-9062222 |
| 2,4-Imidazolidinedione, 1-(1-methylethyl)- | 61893-10-5 | 2A-9062223 |
| 1-Propanone, 1-(4-bromophenyl)-2-chloro- | 87010-95-5 | 2A-9062224 |
| 2,4-Imidazolidinedione, 1-propyl- | 85391-24-8 | 2A-9062225 |
| 2,4-Imidazolidinedione, 1-butyl- | 33599-32-5 | 2A-9062227 |
| Methanone, (4-chlorophenyl)(4-methylphenyl)- | 5395-79-9 | 2A-9062229 |
| Methanone, (4-bromophenyl)(4-chlorophenyl)- | 27428-57-5 | 2A-9062230 |
| Methanone, (4-bromophenyl)(4-fluorophenyl)- | 2069-41-2 | 2A-9062231 |
| Methanone, (4-chlorophenyl)(4-fluorophenyl)- | 2069-48-9 | 2A-9062232 |
| Benzeneacetonitrile, .alpha.-bromo- | 5798-79-8 | 2A-9062233 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA