
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 87010-95-5 |
| Catalog No. | 2A-9062224 |
| Chinese Name | 1-PROPANONE, 1-(4-BROMOPHENYL)-2-CHLORO |
| Synonyms | 4'-Bromo-2-chloropropiophenone |
| Molecular Formula | C16H15BrClNO2 |
| Molecular Weight | 368.66 |
| HTC | 2914700090 |
| MDL Number | MFCD03934078 |
| SMILES | CC(Cl)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H8BrClO/c1-6(11)9(12)7-2-4-8(10)5-3-7/h2-6H,1H3/t6-/m0/s1 |
| InChI Key | XWLIUMZBOPOTCS-UHFFFAOYSA-N |
| MSDS | msds/62224_1_87010_95_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4-Imidazolidinedione, 1-ethyl- | 61893-09-2 | 2A-9062219 |
| 1-Propanone, 2-chloro-1-(4-methoxyphenyl)- | 81112-07-4 | 2A-9062220 |
| 2,4-Imidazolidinedione, 1-methyl- | 616-04-6 | 2A-9062221 |
| 1-Propanone, 2-chloro-1-(4-chlorophenyl)- | 877-38-3 | 2A-9062222 |
| 2,4-Imidazolidinedione, 1-(1-methylethyl)- | 61893-10-5 | 2A-9062223 |
| 2,4-Imidazolidinedione, 1-propyl- | 85391-24-8 | 2A-9062225 |
| 2,4-Imidazolidinedione, 1-butyl- | 33599-32-5 | 2A-9062227 |
| Methanone, (4-chlorophenyl)(4-methoxyphenyl)- | 10547-60-1 | 2A-9062228 |
| Methanone, (4-chlorophenyl)(4-methylphenyl)- | 5395-79-9 | 2A-9062229 |
| Methanone, (4-bromophenyl)(4-chlorophenyl)- | 27428-57-5 | 2A-9062230 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA