
CAS Number33599-32-5
Synonyms1-butyl-imidazolidine-2,4-dione; Hydantoin,1-butyl; EINECS 251-585-6; 1-N-BUTYLHYDANTOIN; 1-Butyl-2,4-dioxoimidazolidine; n-butylhydantoin; 1-butyl-2,4-imidazolidinedione; 1-Butyl-hydantoin
Molecular FormulaC7H12N2O2
Molecular Weight118.07
Density1.12g/cm3
Melting Point94ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33599-32-5 |
| Catalog No. | 2A-9062227 |
| Chinese Name | 1-丁基乙内酰脲 |
| Synonyms | 1-butyl-imidazolidine-2,4-dione; Hydantoin,1-butyl; EINECS 251-585-6; 1-N-BUTYLHYDANTOIN; 1-Butyl-2,4-dioxoimidazolidine; n-butylhydantoin; 1-butyl-2,4-imidazolidinedione; 1-Butyl-hydantoin |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 118.07 |
| Density | 1.12g/cm3 |
| Melting Point | 94ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2933990090 |
| PubChem ID | 329754751 |
| MDL Number | MFCD07366660 |
| SMILES | NN1[13CH2][13C](=O)N[13C]1=O |
| InChI | 1S/C3H5N3O2/c4-6-1-2(7)5-3(6)8/h1,4H2,(H,5,7,8)/i1+1,2+1,3+1 |
| InChI Key | KVYKDNGUEZRPGJ-VMIGTVKRSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/62227_1_33599_32_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4-Imidazolidinedione, 1-methyl- | 616-04-6 | 2A-9062221 |
| 1-Propanone, 2-chloro-1-(4-chlorophenyl)- | 877-38-3 | 2A-9062222 |
| 2,4-Imidazolidinedione, 1-(1-methylethyl)- | 61893-10-5 | 2A-9062223 |
| 1-Propanone, 1-(4-bromophenyl)-2-chloro- | 87010-95-5 | 2A-9062224 |
| 2,4-Imidazolidinedione, 1-propyl- | 85391-24-8 | 2A-9062225 |
| Methanone, (4-chlorophenyl)(4-methoxyphenyl)- | 10547-60-1 | 2A-9062228 |
| Methanone, (4-chlorophenyl)(4-methylphenyl)- | 5395-79-9 | 2A-9062229 |
| Methanone, (4-bromophenyl)(4-chlorophenyl)- | 27428-57-5 | 2A-9062230 |
| Methanone, (4-bromophenyl)(4-fluorophenyl)- | 2069-41-2 | 2A-9062231 |
| Methanone, (4-chlorophenyl)(4-fluorophenyl)- | 2069-48-9 | 2A-9062232 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA