
CAS Number3883-86-1
Synonyms2,2',3,3',5,5',6,6'-Octafluorobiphenyl; 4H,4'H-Octafluorobiphenyl; 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene; EINECS 223-418-7; MFCD00000312
Molecular FormulaC13H10O2
Molecular Weight198.223
Purity97%
Density1.582g/cm3
Boiling Point222.4ºC at 760mmHg
Melting Point84-86 °C(lit.)
AppearanceSolid;White to Almost white powder to crystal
Symbol![9.0, [10.0]](images/Warning.png)
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3883-86-1 |
| Catalog No. | 2A-9005813 |
| Chinese Name | 2,2',3,3',5,5',6,6'-八氟联苯 |
| Synonyms | 2,2',3,3',5,5',6,6'-Octafluorobiphenyl; 4H,4'H-Octafluorobiphenyl; 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene; EINECS 223-418-7; MFCD00000312 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.223 |
| Purity | 97 |
| Density | 1.582g/cm3 |
| Boiling Point | 222.4ºC at 760mmHg |
| Melting Point | 84-86 °C(lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Keep away from light, ventilated and dry, sealed |
| HTC | 2903999090 |
| MDL Number | MFCD11207520 |
| SMILES | Fc1cc(F)c(F)c(-c2c(F)c(F)cc(F)c2F)c1F |
| InChI | InChI=1S/C12H2F8/c13-3-1-4(14)10(18)7(9(3)17)8-11(19)5(15)2-6(16)12(8)20/h1-2H |
| InChI Key | QWCHHUZAAGRHDB-UHFFFAOYSA-N |
| Hazard Symbols | 9.0, [10.0] |
| MSDS | msds/5813_1_3883_86_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Fluoropropiophenone | 456-03-1 | 2A-9005803 |
| 4-Fluororesorcinol | 103068-41-3 | 2A-9005806 |
| 4-Fluorothioanisole | 371-15-3 | 2A-9005807 |
| 4-Fluorothiophenol potassium salt | 132130-83-7 | 2A-9005808 |
| 4-Formylcinnamic acid | 23359-08-2 | 2A-9005809 |
| 4H,5H-Octafluorobiphenyl | 3883-86-2 | 2A-9005814 |
| 4-Heptanolide | 105-21-5 | 2A-9005816 |
| 4-Heptylamine | 16751-59-0 | 2A-9005817 |
| 4-Heptyloxyaniline | 39905-44-7 | 2A-9005818 |
| 4-Heptylphenol | 1987-50-4 | 2A-9005820 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA