
CAS Number456-03-1
Synonymsp-Fluoropropiophenone; 4′-Fluoropropiophenone; para-Fluoropropiophenone; 4-Fluoropropiophenone; Ethyl 4-Fluorophenyl Ketone; 1-(4-fluorophenyl)propan-1-one; 4'-Fluoropropiophenone; 1-(4-Fluorophenyl)-1-propanone; MFCD00000356; EINECS 207-255-9
Molecular FormulaC11H13O1F1
Molecular Weight180.22
Purity98%
Density1.1±0.1 g/cm3
Boiling Point215.9±13.0 °C at 760 mmHg
AppearanceTransparent yellow liquid after melting point
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 456-03-1 |
| Catalog No. | 2A-9005803 |
| Chinese Name | 4'-氟苯丙酮 |
| Synonyms | p-Fluoropropiophenone; 4′-Fluoropropiophenone; para-Fluoropropiophenone; 4-Fluoropropiophenone; Ethyl 4-Fluorophenyl Ketone; 1-(4-fluorophenyl)propan-1-one; 4'-Fluoropropiophenone; 1-(4-Fluorophenyl)-1-propanone; MFCD00000356; EINECS 207-255-9 |
| Molecular Formula | C11H13O1F1 |
| Molecular Weight | 180.22 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 215.9±13.0 °C at 760 mmHg |
| Appearance | Transparent yellow liquid after melting point |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| HTC | 2914700090 |
| MDL Number | MFCD01938606 |
| SMILES | CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChI Key | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/5803_1_456_03_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluorophenyl sulphone | 383-29-9 | 2A-9005797 |
| 4-Fluorophenylacetic acid | 405-50-5 | 2A-9005798 |
| 4-Fluorophenylacetyl chloride | 459-04-1 | 2A-9005799 |
| 4-Fluorophenylhydrazine hydrochloride | 823-85-8 | 2A-9005800 |
| 4-Fluorophthalic acid | 320-97-8 | 2A-9005801 |
| 4-Fluororesorcinol | 103068-41-3 | 2A-9005806 |
| 4-Fluorothioanisole | 371-15-3 | 2A-9005807 |
| 4-Fluorothiophenol potassium salt | 132130-83-7 | 2A-9005808 |
| 4-Formylcinnamic acid | 23359-08-2 | 2A-9005809 |
| 4H,4'H-Octafluorobiphenyl | 3883-86-1 | 2A-9005813 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA