
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39905-44-7 |
| Catalog No. | 2A-9005818 |
| Chinese Name | 4-正庚氧基苯胺 |
| Synonyms | 4-heptoxyaniline; 4-n-Heptyloxyaniline; MFCD00038135; 4-(HEPTYLOXY)ANILINE |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.31 |
| Purity | 96 |
| Density | 0.965g/cm3 |
| Boiling Point | 145 °C |
| Melting Point | 44-48 °C(lit.) |
| Storage Condition | Sealed, cool, dry storage |
| HTC | 2922299090 |
| MDL Number | MFCD00038135 |
| SMILES | CCCCCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
| InChI Key | LTGYTOOKQWFTQG-UHFFFAOYSA-N |
| MSDS | msds/5818_1_39905_44_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Formylcinnamic acid | 23359-08-2 | 2A-9005809 |
| 4H,4'H-Octafluorobiphenyl | 3883-86-1 | 2A-9005813 |
| 4H,5H-Octafluorobiphenyl | 3883-86-2 | 2A-9005814 |
| 4-Heptanolide | 105-21-5 | 2A-9005816 |
| 4-Heptylamine | 16751-59-0 | 2A-9005817 |
| 4-Heptylphenol | 1987-50-4 | 2A-9005820 |
| 4-Hydrazinobenzoic acid | 619-67-0 | 2A-9005822 |
| 4-Hydrazino-N-methylbenzenemethanesulfonamide | 88933-16-8 | 2A-9005823 |
| 4-Hydroxy 6-methylnicotinic acid | 67367-33-3 | 2A-9005824 |
| 4'-Hydroxy-2'-methylacetophenone | 875-59-2 | 2A-9005839 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA