
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 668270-12-0 |
| Catalog No. | 2A-0202309 |
| Chinese Name | 利格列汀 |
| Synonyms | BI-1356-BS; Ondero; BI-1356; Trajenta; Linagliptin; Tradjenta |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.54 |
| Purity | ≥98 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 661.2±65.0 °C at 760 mmHg |
| Melting Point | 202ºC |
| Appearance | powder |
| Storage Condition | 2-8C |
| Application | Linagliptin is a potent and selective DPP-4 inhibitor with an IC50 value of 1 nM. |
| MDL Number | MFCD14635356 |
| SMILES | N5(C[C@@H](CCC5)N)c1[n](c2c([n]([c]([n]([c]2=O)Cc3nc4c(c(n3)C)cccc4)=O)C)n1)CC#CC |
| InChI | 1S/C25H28N8O2/c1-4-5-13-32-21-22(29-24(32)31-12-8-9-17(26)14-31)30(3)25(35)33(23(21)34)15-20-27-16(2)18-10-6-7-11-19(18)28-20/h6-7,10-11,17H,8-9,12-15,26H2,1-3H3/t17-/m1/s1 |
| InChI Key | LTXREWYXXSTFRX-QGZVFWFLSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 51111800 |
| MSDS | msds/57842_1_668270_12_0.pdf |
| Transport Info | Product Name: Linagliptin |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Sunitinib | 557795-19-4 | 2A-9057603 |
| tert-Buthyl Pitavastatin | 586966-54-3 | 2A-9057635 |
| Carvedilol phosphate hemihydrate | 610309-89-2 | 2A-9057706 |
| Sitagliptin phosphate monohydrate | 654671-77-9 | 2A-9057813 |
| Sitagliptin phosphate | 654671-78-0 | 2A-9057814 |
| Neratinib | 698387-09-6 | 2A-9057939 |
| Regorafenib | 755037-03-7 | 2A-9058087 |
| Olaparib | 763113-22-0 | 2A-9058118 |
| Canagliflozin | 842133-18-0 | 2A-9058288 |
| Alogliptin benzoate | 850649-62-6 | 2A-9058379 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA