
CAS Number308103-40-4
Synonyms2-acetylbenzeneboronic acid; (2-Acetylphenyl)boronic acid; 2-Acetylphenylboronic Acid; o-acetylphenylboronic acid; ortho-acetylphenylboronic acid; 2-acetylphenylboronicacid; MFCD01321263
Molecular FormulaC8H9O3B1
Molecular Weight163.97
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point349.9±44.0 °C at 760 mmHg
Melting Point170 °C (dec.)(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 308103-40-4 |
| Catalog No. | 2A-9056466 |
| Chinese Name | 2-乙酰基苯硼酸 |
| Synonyms | 2-acetylbenzeneboronic acid; (2-Acetylphenyl)boronic acid; 2-Acetylphenylboronic Acid; o-acetylphenylboronic acid; ortho-acetylphenylboronic acid; 2-acetylphenylboronicacid; MFCD01321263 |
| Molecular Formula | C8H9O3B1 |
| Molecular Weight | 163.97 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 349.9±44.0 °C at 760 mmHg |
| Melting Point | 170 °C (dec.)(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2931900090 |
| MDL Number | MFCD25972977 |
| SMILES | CC(=O)c1ccccc1B(O)O |
| InChI | InChI=1S/C8H9BO3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5,11-12H,1H3 |
| InChI Key | ZKAOVABYLXQUTI-UHFFFAOYSA-N |
| MSDS | msds/56466_1_308103_40_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product Name: 2-Acetylphenylboronic acid |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| (Z)-1-Phenyl-3-(4-(trifluoromethyl)phenylimino)indolin-2-one | 303984-47-6 | 2A-9056429 |
| 3-Cyano-5-fluorophenylboronic acid | 304858-67-1 | 2A-9056439 |
| 5-Cyanothiophene-2-boronic acid | 305832-67-1 | 2A-9056445 |
| 6-Fluoro-4H-1,3-benzodioxine-8-carbaldehyde | 306934-87-2 | 2A-9056448 |
| 8-Trifluoromethoxy-2-(trifluoromethyl)quinolin-4-ol | 306935-26-2 | 2A-9056451 |
| Bis(diethyl-D-tartrate glycolato)diboron | 312693-46-2 | 2A-9056481 |
| 2-Chloro-4-(trifluoromethyl)phenylboronic acid | 313545-41-4 | 2A-9056498 |
| [4-(4-Butylcyclohexyl)phenyl]boronic acid | 315220-11-2 | 2A-9056511 |
| Methyl indolizine-1-carboxylate | 316375-85-6 | 2A-9056517 |
| 2-(4-((2-(4-(Trifluoromethyl)phenyl)-5-methylthiazol-4-yl)methylthio)-2-methylphenoxy)acetic acid | 317318-70-0 | 2A-9056519 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA