
CAS Number305832-67-1
Synonyms(5-Cyano-2-thienyl)boronic acid; 5-cyanothiophene-2-boronic acid; 5-cyanothiophen-2-yl-2-boronic acid; 5-cyano-2-thiophene boronic acid; 5-cyanothiophen-2-ylboronic acid; MFCD02094029; 5-cyano-2-thiophenyl boronic acid; (5-Cyanothiophen-2-yl)boronic acid; 5-Boronothiophene-2-carbonitrile
Molecular FormulaC5H4BNO2S
Molecular Weight152.967
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point369.3±52.0 °C at 760 mmHg
Melting Point175 °C
AppearancePink to beige powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 305832-67-1 |
| Catalog No. | 2A-9056445 |
| Chinese Name | 5-氰基噻吩-2-硼酸 |
| Synonyms | (5-Cyano-2-thienyl)boronic acid; 5-cyanothiophene-2-boronic acid; 5-cyanothiophen-2-yl-2-boronic acid; 5-cyano-2-thiophene boronic acid; 5-cyanothiophen-2-ylboronic acid; MFCD02094029; 5-cyano-2-thiophenyl boronic acid; (5-Cyanothiophen-2-yl)boronic acid; 5-Boronothiophene-2-carbonitrile |
| Molecular Formula | C5H4BNO2S |
| Molecular Weight | 152.967 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 369.3±52.0 °C at 760 mmHg |
| Melting Point | 175 °C |
| Appearance | Pink to beige powder |
| Water Solubility | insoluble |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2934999090 |
| SMILES | N#Cc1ccc(B(O)O)s1 |
| InChI | InChI=1S/C5H4BNO2S/c7-3-4-1-2-5(10-4)6(8)9/h1-2,8-9H |
| InChI Key | ZEOMEPSYIIQIND-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/56445_1_305832_67_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone | 299169-54-3 | 2A-9056393 |
| tert-Butyl 1-oxa-5-azaspiro[2.4]heptane-5-carboxylate | 301226-25-5 | 2A-9056405 |
| 3,5-Dimethyl-4-methoxyphenylboronic acid | 301699-39-8 | 2A-9056410 |
| (Z)-1-Phenyl-3-(4-(trifluoromethyl)phenylimino)indolin-2-one | 303984-47-6 | 2A-9056429 |
| 3-Cyano-5-fluorophenylboronic acid | 304858-67-1 | 2A-9056439 |
| 6-Fluoro-4H-1,3-benzodioxine-8-carbaldehyde | 306934-87-2 | 2A-9056448 |
| 8-Trifluoromethoxy-2-(trifluoromethyl)quinolin-4-ol | 306935-26-2 | 2A-9056451 |
| 2-Acetylphenylboronic acid | 308103-40-4 | 2A-9056466 |
| Bis(diethyl-D-tartrate glycolato)diboron | 312693-46-2 | 2A-9056481 |
| 2-Chloro-4-(trifluoromethyl)phenylboronic acid | 313545-41-4 | 2A-9056498 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA