
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261764-92-5 |
| Catalog No. | 2A-9056120 |
| Chinese Name | 2-氯-4-硝基-1,3-苯二胺 |
| Synonyms | 2-chloro-4-nitro-1,3-benzenediammine; 2-chloranyl-4-nitro-benzene-1,3-diamine |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.838 |
| Purity | 98.00 |
| Density | 1.592 g/cm3 |
| Boiling Point | 393.2ºC at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2921519090 |
| MDL Number | MFCD00022009 |
| SMILES | Nc1ccc([N+](=O)[O-])c(N)c1Cl |
| InChI Key | NTLGTOMYCVBTHT-UHFFFAOYSA-N |
| MSDS | msds/56120_1_261764_92_5.pdf |
| Tax Rebate | 17.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921519090. o-, m-, p-phenylenediamine, diaminotoluenes, and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-iodobenzotrifluoride | 260355-20-2 | 2A-9056101 |
| 5-(9-Fluorenylmethyloxycarbonylamino)-3-oxapentanoic acid | 260367-12-2 | 2A-9056102 |
| (7a,17b)-7-7-[9-[(4,4,5,5,5-Pentafluoropentyl)sulfinyl]nonyl]-estra-1,3,5(10)-triene-3,17-diol 17-acetate | 261506-24-5 | 2A-9056115 |
| 6-(Methylamino)nicotinonitrile | 261715-36-0 | 2A-9056116 |
| 3-Chloro-2,6-difluorobenzoyl chloride | 261762-43-0 | 2A-9056119 |
| (2R)-3-Bromo-2-hydroxy-2-methylpropanoic acid | 261904-39-6 | 2A-9056126 |
| 3-Fluoro-4-methylphenylacetonitrile | 261951-73-9 | 2A-9056127 |
| 2-Bromo-5-methylbenzotrifluoride | 261952-20-9 | 2A-9056132 |
| 4-Methoxy-2-methylphenylacetonitrile | 262298-02-2 | 2A-9056136 |
| Torcetrapib | 262352-17-0 | 2A-9056138 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA