
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-43-0 |
| Catalog No. | 2A-9056119 |
| Chinese Name | 3-氯-2,6-二氟苯甲酰氯 |
| Synonyms | jrd-1003; pc0001; MFCD01631324 |
| Molecular Formula | C6H2O2Cl2S1F2 |
| Molecular Weight | 247.05 |
| Purity | 98.00 |
| Density | 1.548g/cm3 |
| Boiling Point | 203.9ºC at 760mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | II |
| HTC | 2916399090 |
| MDL Number | MFCD12922595 |
| SMILES | O=C(Cl)c1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C7H2Cl2F2O/c8-3-1-2-4(10)5(6(3)11)7(9)12/h1-2H |
| InChI Key | LUTDLSSUGZTZBP-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/56119_1_261762_43_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cucurbit[8]uril | 259886-51-6 | 2A-9056097 |
| 2-Chloro-5-iodobenzotrifluoride | 260355-20-2 | 2A-9056101 |
| 5-(9-Fluorenylmethyloxycarbonylamino)-3-oxapentanoic acid | 260367-12-2 | 2A-9056102 |
| (7a,17b)-7-7-[9-[(4,4,5,5,5-Pentafluoropentyl)sulfinyl]nonyl]-estra-1,3,5(10)-triene-3,17-diol 17-acetate | 261506-24-5 | 2A-9056115 |
| 6-(Methylamino)nicotinonitrile | 261715-36-0 | 2A-9056116 |
| 2-Chloro-4-nitro-1,3-phenylenediamine | 261764-92-5 | 2A-9056120 |
| (2R)-3-Bromo-2-hydroxy-2-methylpropanoic acid | 261904-39-6 | 2A-9056126 |
| 3-Fluoro-4-methylphenylacetonitrile | 261951-73-9 | 2A-9056127 |
| 2-Bromo-5-methylbenzotrifluoride | 261952-20-9 | 2A-9056132 |
| 4-Methoxy-2-methylphenylacetonitrile | 262298-02-2 | 2A-9056136 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA