![4-Nitro-N-[2-(4-nitrophenoxy)ethyl]benzeneethanamine structure, CAS 226992-13-8](/structures/60000/55838_1_226992_13_8.png)
CAS Number226992-13-8
Synonyms2-(4-Nitrophenoxy)-N-[2-(4-nitrophenyl)ethyl]ethanamine; [2-(4-nitrophenyl)ethyl]{2-[(4-nitrophenyl)oxy]ethyl}amine; FC0815; N-[2-(p-nitrophenoxy)ethyl]-p-nitrophenethylamine; 4-Nitro-N-[2-(4-nitrophenoxy)ethyl]benzeneethanamine; N-(2-(4-nitrophenoxy)ethyl)-2-(4-nitrophenyl)ethanamine
Molecular FormulaC15H13FN2O5
Molecular Weight320.28
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point520.5±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 226992-13-8 |
| Catalog No. | 2A-9055838 |
| Chinese Name | 4-硝基-N-[2-(4-硝基苯氧基)乙基]苯乙胺 |
| Synonyms | 2-(4-Nitrophenoxy)-N-[2-(4-nitrophenyl)ethyl]ethanamine; [2-(4-nitrophenyl)ethyl]{2-[(4-nitrophenyl)oxy]ethyl}amine; FC0815; N-[2-(p-nitrophenoxy)ethyl]-p-nitrophenethylamine; 4-Nitro-N-[2-(4-nitrophenoxy)ethyl]benzeneethanamine; N-(2-(4-nitrophenoxy)ethyl)-2-(4-nitrophenyl)ethanamine |
| Molecular Formula | C15H13FN2O5 |
| Molecular Weight | 320.28 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 520.5±40.0 °C at 760 mmHg |
| HTC | 2922299090 |
| MDL Number | MFCD00095260 |
| SMILES | O=[N+]([O-])c1ccc(CCNCCOc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI Key | MYUWQXUKSBKSDS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Di-tert-butylphosphino)biphenyl | 224311-51-7 | 2A-9055812 |
| Retapamulin | 224452-66-8 | 2A-9055814 |
| Basic Green 5 | 224967-52-6 | 2A-9055820 |
| 2-(2-tert-Butyl-6-methylpyran-4-ylidene)malononitrile | 225378-53-0 | 2A-9055823 |
| Cinacalcet | 226256-56-0 | 2A-9055833 |
| N-Ethyl-3-trimethoxysilyl-2-methylpropanamine | 227085-51-0 | 2A-9055839 |
| 3-Mercapto-2-methylpenta-1-ol | 227456-27-1 | 2A-9055840 |
| 3-Mercapto-2-methylpentanal | 227456-28-2 | 2A-9055841 |
| 2-Fluoro-5-(hydroxymethyl)benzonitrile | 227609-85-0 | 2A-9055842 |
| 1-[(4-Methoxyphenyl)methyl]-1H-pyrazol-5-amine monohydrochloride | 227617-24-5 | 2A-9055844 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA