CAS Number50663-21-3
Synonyms4-BromocinnamicAcid; MFCD00004394; P-BROMOCINNAMIC ACID; p-Bromophenyl acrylate; 4-Bromocimnamic Acid; 4'-bromophenyl 2-propenoate; RARECHEM BK HD C006; 4-Bromophenyl acrylate; BROMOCINNAMIC ACID,4; EINECS 214-850-7
Molecular FormulaC9H7O2Br1
Molecular Weight227.06
Purity98.00%
Density1.607 g/cm3
Boiling Point344.9ºC at 760 mmHg
Melting Point262ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50663-21-3 |
| Catalog No. | 2A-9005501 |
| Chinese Name | 4-溴肉桂酸 |
| Synonyms | 4-BromocinnamicAcid; MFCD00004394; P-BROMOCINNAMIC ACID; p-Bromophenyl acrylate; 4-Bromocimnamic Acid; 4'-bromophenyl 2-propenoate; RARECHEM BK HD C006; 4-Bromophenyl acrylate; BROMOCINNAMIC ACID,4; EINECS 214-850-7 |
| Molecular Formula | C9H7O2Br1 |
| Molecular Weight | 227.06 |
| Purity | 98.00 |
| Density | 1.607 g/cm3 |
| Boiling Point | 344.9ºC at 760 mmHg |
| Melting Point | 262ºC |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| MDL Number | MFCD27920518 |
| SMILES | [O-]C(=O)\C=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/p-1/b6-3+ |
| InChI Key | InChIKey=CPDDDTNAMBSPRN-ZZXKWVIFSA-M |
| MSDS | msds/5501_1_50663_21_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromobenzyl chloride | 589-17-3 | 2A-9005490 |
| 4-Bromobenzylamine hydrochloride | 26177-44-6 | 2A-9005493 |
| 4-Bromobenzylisocyanide | 602261-85-8 | 2A-9005495 |
| 4-Bromobenzylmethylsulfone | 213627-30-6 | 2A-9005497 |
| 4-Bromobiphenyl | 92-66-0 | 2A-9005499 |
| 4-Bromodiphenylmethane | 2116-36-1 | 2A-9005503 |
| 4-Bromo-D-phenylalanine | 62561-74-4 | 2A-9005504 |
| 4-Bromoethylbenzene | 1585-07-5 | 2A-9005505 |
| 4-Bromoindan-1-one | 15115-60-3 | 2A-9005506 |
| 4-Bromoisophthalic acid | 6939-93-1 | 2A-9005508 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS