
CAS Number589-17-3
SynonymsEINECS 209-638-6; MFCD00040867; 1-Bromo-4-(chloromethyl)benzene; 4-Bromobenzyl chloride
Molecular FormulaC7H6BrCl
Molecular Weight205.480
Purity97%
Density1.5±0.1 g/cm3
Boiling Point236.0±0.0 °C at 760 mmHg
Melting Point36-40 °C
AppearanceLight yellow crystal powder to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 589-17-3 |
| Catalog No. | 2A-9005490 |
| Chinese Name | 4-溴苄氯 |
| Synonyms | EINECS 209-638-6; MFCD00040867; 1-Bromo-4-(chloromethyl)benzene; 4-Bromobenzyl chloride |
| Molecular Formula | C7H6BrCl |
| Molecular Weight | 205.480 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 236.0±0.0 °C at 760 mmHg |
| Melting Point | 36-40 °C |
| Appearance | Light yellow crystal powder to light yellow liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| HTC | 2903999090 |
| SMILES | ClCc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| InChI Key | BSIIGUGKOPPTPZ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/5490_1_589_17_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromobenzhydrol | 29334-16-5 | 2A-9005484 |
| 4'-Bromobenzo-18-crown-6 | 75460-28-5 | 2A-9005486 |
| 4-Bromobenzonitrile | 623-00-7 | 2A-9005487 |
| 4-Bromobenzophenone | 90-90-4 | 2A-9005488 |
| 4-Bromobenzoyl chloride | 586-75-4 | 2A-9005489 |
| 4-Bromobenzylamine hydrochloride | 26177-44-6 | 2A-9005493 |
| 4-Bromobenzylisocyanide | 602261-85-8 | 2A-9005495 |
| 4-Bromobenzylmethylsulfone | 213627-30-6 | 2A-9005497 |
| 4-Bromobiphenyl | 92-66-0 | 2A-9005499 |
| 4-Bromocinnamic acid | 50663-21-3 | 2A-9005501 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA