CAS Number1585-07-5
Synonyms4-Bromoethylbenzene; EINECS 216-439-8; P-Bromoethylbenzene; β-Phenethyl bromide; 1-phenethyl bromide; β-Bromoethylbenzene; (BROMOMETHYL)METHYLBENZENE; β-Phenylethyl bromide; 1-Bromo-4-ethylbenzene; (2-Bromoethyl)benzene; MFCD00000111
Molecular FormulaC8H9Br
Molecular Weight185.061
Purity99.5%
Density1.3±0.1 g/cm3
Boiling Point204.6±9.0 °C at 760 mmHg
Melting Point-43°C
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1585-07-5 |
| Catalog No. | 2A-9005505 |
| Chinese Name | 1-溴-4-乙基苯 |
| Synonyms | 4-Bromoethylbenzene; EINECS 216-439-8; P-Bromoethylbenzene; β-Phenethyl bromide; 1-phenethyl bromide; β-Bromoethylbenzene; (BROMOMETHYL)METHYLBENZENE; β-Phenylethyl bromide; 1-Bromo-4-ethylbenzene; (2-Bromoethyl)benzene; MFCD00000111 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.061 |
| Purity | 99.5 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 204.6±9.0 °C at 760 mmHg |
| Melting Point | -43°C |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| HTC | 29036990 |
| SMILES | CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H9Br/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| InChI Key | URFPRAHGGBYNPW-UHFFFAOYSA-N |
| MSDS | msds/5505_2_1585_07_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromobenzylmethylsulfone | 213627-30-6 | 2A-9005497 |
| 4-Bromobiphenyl | 92-66-0 | 2A-9005499 |
| 4-Bromocinnamic acid | 50663-21-3 | 2A-9005501 |
| 4-Bromodiphenylmethane | 2116-36-1 | 2A-9005503 |
| 4-Bromo-D-phenylalanine | 62561-74-4 | 2A-9005504 |
| 4-Bromoindan-1-one | 15115-60-3 | 2A-9005506 |
| 4-Bromoisophthalic acid | 6939-93-1 | 2A-9005508 |
| 4-Bromojulolidine | 70173-54-5 | 2A-9005510 |
| 4-Bromomandelic acid | 6940-50-7 | 2A-9005512 |
| 4-Bromo-N-(1,1-dimethylethyl)benzamide | 42498-38-4 | 2A-9005519 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS