
CAS Number80370-42-9
SynonymsPropanoic acid,2-formyl-3-oxo-,ethyl ester; ethoxycarbonylmalonaldehyde; (ethoxycarbonyl)malonodialdehyde; (ethoxycarbonyl)malonedialdehyde; Ethyl-2-formyl-3-oxopropionate; (ethoxycarbonyl)malondialdehyde; ethyl 2,2-diformylacetate; Ethyl 2-formyl-3-oxopropanoate; 2-FORMYL-3-OXO-PROPANOIC ACID ETHYL ESTER; Propanoic acid, 2-formyl-3-oxo-, ethyl ester
Molecular FormulaC6H8O4
Molecular Weight144.13
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point181.5±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80370-42-9 |
| Catalog No. | 2A-9048470 |
| Chinese Name | 2-甲酰基-3-氧代丙酸乙酯 |
| Synonyms | Propanoic acid,2-formyl-3-oxo-,ethyl ester; ethoxycarbonylmalonaldehyde; (ethoxycarbonyl)malonodialdehyde; (ethoxycarbonyl)malonedialdehyde; Ethyl-2-formyl-3-oxopropionate; (ethoxycarbonyl)malondialdehyde; ethyl 2,2-diformylacetate; Ethyl 2-formyl-3-oxopropanoate; 2-FORMYL-3-OXO-PROPANOIC ACID ETHYL ESTER; Propanoic acid, 2-formyl-3-oxo-, ethyl ester |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 181.5±35.0 °C at 760 mmHg |
| Storage Condition | -20℃ |
| HTC | 2918300090 |
| PubChem ID | 16093240 |
| SMILES | CCOC(=O)C(C=O)C=O |
| InChI | InChI=1S/C6H8O4/c1-2-10-6(9)5(3-7)4-8/h3-5H,2H2,1H3 |
| InChI Key | HMFLBGNCDZYITR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4,5-Trifluorobenzotrifluoride | 80172-04-9 | 2A-9048454 |
| 1-Iodoethyl ethyl carbonate | 80196-04-9 | 2A-9048456 |
| Cucurbit[6]uril hydrate | 80262-44-8 | 2A-9048463 |
| 2-Chloro-1-(4-isobutylphenyl)propan-1-one | 80336-66-9 | 2A-9048467 |
| 4-Bromophenylglyoxal hydrate | 80352-42-7 | 2A-9048468 |
| Methyl 5-amino-2-methansulfonyloxybenzoate | 80430-22-4 | 2A-9048475 |
| 1-Ethyl-3-methylimidazolium tetrachloroaluminate | 80432-05-9 | 2A-9048476 |
| Calcium levofolinate | 80433-71-2 | 2A-9048477 |
| (6a,11b,16a,17a)-6,9-Difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioic acid | 80473-92-3 | 2A-9048485 |
| (6a,11b,16a,17a)-6,9-Difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)-androsta-1,4-diene-17-carbothioic acid | 80474-45-9 | 2A-9048487 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA